
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 39162-75-9 |
| Catalog No. | 2A-9042276 |
| Chinese Name | L-天门冬氨酸钙 |
| Synonyms | Calcium hydrogen (2S)-2-aminosuccinate (1:2:2); Butanedioate, 2-amino-, calcium hydrogen salt, (2S)- (2:1:2) |
| Molecular Formula | C8H12CaN2O8 |
| Molecular Weight | 304.267 |
| Purity | 98.00 |
| Melting Point | 270-271ºC |
| Storage Condition | room temperature |
| HTC | 2922499990 |
| PubChem ID | 164831168 |
| SMILES | NC(CC(=O)O)C(=O)[O-].NC(CC(=O)O)C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1 |
| InChI Key | VAFAEQCKZBKRLZ-CEOVSRFSSA-L |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl 2-chloro-6-methylnicotinate | 39073-14-8 | 2A-9042259 |
| 3,5-Dimethylphenylacetonitrile | 39101-54-7 | 2A-9042264 |
| 1-[(4-Chlorophenyl)oxy]-2-nitrobenzene | 39145-47-6 | 2A-9042269 |
| tert-Butyl 2-bromopropionate | 39149-80-9 | 2A-9042271 |
| Thulium acetate | 39156-80-4 | 2A-9042274 |
| Isonicotinoyl chloride hydrochloride | 39178-35-3 | 2A-9042277 |
| (E)-1-Iodo-1-octen-3-one | 39178-64-8 | 2A-9042280 |
| 3-Methyl-N-methylbenzylamine | 39180-84-2 | 2A-9042281 |
| Corey PG-lactone diol | 39182-59-7 | 2A-9042282 |
| 3-Chloro-N-methylbenzylamine | 39191-07-6 | 2A-9042285 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA