CAS Number38902-87-3
Synonyms2,4-Dichloro-3-nitrophenol; 2,4-Dichlor-3-nitro-phenol; 3-nitro-2,4-dichlorophenol; 2,4-bis(chloranyl)-3-nitro-phenol; 2,4-dichloro-3-nitro-phenol; Phenol,2,4-dichloro-3-nitro; 2,6-Dichloro-3-hydroxynitrobenzene; 2,4'-DIHYDROXYDIPHENYL SULFONE; 2.4-Dichlor-3-nitro-1-hydroxy-benzol; MFCD08059572
Molecular FormulaC6H3Cl2NO3
Molecular Weight242.53
Purity98.00%
Density1.7±0.1 g/cm3
Boiling Point314.5±42.0 °C at 760 mmHg
Melting Point81-82°C
AppearanceWhite to yellow solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 38902-87-3 |
| Catalog No. | 2A-9042226 |
| Chinese Name | 2,4-二氯-3-硝基酚 |
| Synonyms | 2,4-Dichloro-3-nitrophenol; 2,4-Dichlor-3-nitro-phenol; 3-nitro-2,4-dichlorophenol; 2,4-bis(chloranyl)-3-nitro-phenol; 2,4-dichloro-3-nitro-phenol; Phenol,2,4-dichloro-3-nitro; 2,6-Dichloro-3-hydroxynitrobenzene; 2,4'-DIHYDROXYDIPHENYL SULFONE; 2.4-Dichlor-3-nitro-1-hydroxy-benzol; MFCD08059572 |
| Molecular Formula | C6H3Cl2NO3 |
| Molecular Weight | 242.53 |
| Purity | 98.00 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 314.5±42.0 °C at 760 mmHg |
| Melting Point | 81-82°C |
| Appearance | White to yellow solid |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2908999090 |
| PubChem ID | 33677028 |
| MDL Number | MFCD00270793 |
| SMILES | Clc1c(c(cc(c1CC)Cl)N)O.Cl |
| InChI | InChI=1S/C11H17N3O2.2ClH/c1-11(2,3)16-10(15)14-9-6-8(7-12)4-5-13-9;;/h4-6H,7,12H2,1-3H3,(H,13,14,15);2*1H |
| InChI Key | XZZITYVICUAZNB-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/42226_1_38902_87_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product Name: Summary 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Dichloropyrimidine-5-carboxylic acid | 37131-89-8 | 2A-9041918 |
| 5-Acetyl-2,4-dimethylthiazole | 38205-60-6 | 2A-9042097 |
| 2,4-Dichloro-1-(2-nitrophenoxy)benzene | 38461-29-9 | 2A-9042149 |
| Tetrakis(2,4-di-tert-butylphenyl)-1,1-biphenyl-4,4'-diylbisphosphonite | 38613-77-3 | 2A-9042175 |
| Glyphosate isopropylamine salt | 38641-94-0 | 2A-9042179 |
| 1-(3-Allyl-2,4-dihydroxyphenyl)ethanone | 38987-00-7 | 2A-9042241 |
| 2,4-Diaminoanisole sulfate | 39156-41-7 | 2A-9042273 |
| 2,4-Dichloro-5-nitrophenol | 39489-77-5 | 2A-9042330 |
| 2,4-Dichloro-3-methyl-6-nitrophenol | 39549-27-4 | 2A-9042353 |
| 2,4-Dichloropyrido[3,2-d]pyrimidine | 39551-54-7 | 2A-9042356 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS