
CAS Number38820-59-6
Synonymshexamethylenediamine tetra(methylene phosphonic acid) hexapotassium salt; Hexamethylenediamine Tetra(methylene Phosphonic Acid) Potassium Salt; HMDTMPAK6; (Hexan-1,6-diylbis(nitrilobis(methylen)))tetrakisphosphonsure,Kaliumsalz; K6HDTMP; Potassium Salt of HexaMethyleneDiamineTetra (MethylenePhosphonic Acid); Hexamethylenediaminetetrakis-(methylenephosphonic acid) potassium salt; aminotetra(methylenephosphonic acid) potassium salt
Molecular FormulaC10H22K6N2O12P4
Molecular Weight720.77300
Purity98.00%
Boiling Point865.3ºC at 760mmHg
AppearanceWater white to light yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 38820-59-6 |
| Catalog No. | 2A-9042209 |
| Chinese Name | 己二胺四甲叉膦酸六钾盐 |
| Synonyms | hexamethylenediamine tetra(methylene phosphonic acid) hexapotassium salt; Hexamethylenediamine Tetra(methylene Phosphonic Acid) Potassium Salt; HMDTMPAK6; (Hexan-1,6-diylbis(nitrilobis(methylen)))tetrakisphosphonsure,Kaliumsalz; K6HDTMP; Potassium Salt of HexaMethyleneDiamineTetra (MethylenePhosphonic Acid); Hexamethylenediaminetetrakis-(methylenephosphonic acid) potassium salt; aminotetra(methylenephosphonic acid) potassium salt |
| Molecular Formula | C10H22K6N2O12P4 |
| Molecular Weight | 720.77300 |
| Purity | 98.00 |
| Boiling Point | 865.3ºC at 760mmHg |
| Appearance | Water white to light yellow liquid |
| PubChem ID | 33517131 |
| SMILES | O=P([O-])(O)CN(CCCCCCN(CP(=O)([O-])O)CP(=O)([O-])O)CP(=O)([O-])O.[K+] |
| InChI | InChI=1S/C10H28N2O12P4.K/c13-25(14,15)7-11(8-26(16,17)18)5-3-1-2-4-6-12(9-27(19,20)21)10-28(22,23)24;/h1-10H2,(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24);/q;+1/p-4 |
| InChI Key | FZMFRKUYWHTRFD-UHFFFAOYSA-J |
| Transport Info | Product name: Hexapotassium hexamethylene diamine tetramethylene phosphonate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Aminopyridin-2-ol | 38767-72-5 | 2A-9042202 |
| 4-Bromo-1-butyne | 38771-21-0 | 2A-9042203 |
| 2,4'-Dibromopropiophenone | 38786-67-3 | 2A-9042206 |
| 4-Phenoxyphthalonitrile | 38791-62-7 | 2A-9042207 |
| 4-Chloro-3-nitrobenzoyl chloride | 38818-50-7 | 2A-9042208 |
| 4-Hydroxy-5-methyl-2-hexanone | 38836-21-4 | 2A-9042213 |
| Trisguanidinium phosphate | 38848-02-1 | 2A-9042214 |
| Methoxyacetyl chloride | 38870-89-2 | 2A-9042219 |
| 1-Acetoxy-4-chloro-3-methyl-2-butene | 38872-49-0 | 2A-9042220 |
| 2-Bromo-6-nitrobenzoic acid | 38876-67-4 | 2A-9042222 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA