
CAS Number38690-77-6
SynonymsMFCD00001816; EINECS 254-085-6; (4-cyanophenyl) 4-butylbenzoate; 4-CYANOPHENYL 4-N-BUTYLBENZOATE
Molecular FormulaC18H17NO2
Molecular Weight279.34
Purity98.00%
Density1.14 g/cm3
Boiling Point441.9ºC at 760 mmHg
Melting Point67-69 °C(lit.)
AppearanceSolid;White to Light yellow powder to crystal
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 38690-77-6 |
| Catalog No. | 2A-9042189 |
| Chinese Name | 4-丁基苯甲酸-4-氰基苯酯 |
| Synonyms | MFCD00001816; EINECS 254-085-6; (4-cyanophenyl) 4-butylbenzoate; 4-CYANOPHENYL 4-N-BUTYLBENZOATE |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 |
| Purity | 98.00 |
| Density | 1.14 g/cm3 |
| Boiling Point | 441.9ºC at 760 mmHg |
| Melting Point | 67-69 °C(lit.) |
| Appearance | Solid;White to Light yellow powder to crystal |
| Storage Condition | Sealed, cool and dry storage |
| Packaging | III |
| HTC | 2926909090 |
| PubChem ID | 6465917 |
| SMILES | CCCCc1ccc(C(=O)Oc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C18H17NO2/c1-2-3-4-14-5-9-16(10-6-14)18(20)21-17-11-7-15(13-19)8-12-17/h5-12H,2-4H2,1H3 |
| InChI Key | XQRFASOUJIKXRE-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,5-Diethoxy-4-[(4-methylphenyl)thio]-benzenediazonium tetrachlorozincate | 38656-51-8 | 2A-9042184 |
| 1,1'-((4-Methylphenyl)imino)bis-2-propanol | 38668-48-3 | 2A-9042185 |
| 4-tert-Butylphenyl cyclopropyl ketone | 38675-79-5 | 2A-9042186 |
| 9b,11b-Epoxy-17,21-dihydroxypregna-1,4-diene-3,20-dione 21-acetate | 38680-83-0 | 2A-9042187 |
| 4-Cyanophenyl 4-heptylbenzoate | 38690-76-5 | 2A-9042188 |
| 2,2-Dimethoxy-N,N-dimethylethylamine | 38711-20-5 | 2A-9042191 |
| Lithium triisobutylhydroborate | 38721-52-7 | 2A-9042192 |
| 4-(Methylthio)phenylacetonitrile | 38746-92-8 | 2A-9042193 |
| 5-BroMo-2-ethylpyidine | 38749-90-5 | 2A-9042198 |
| 4-Aminopyridin-2-ol | 38767-72-5 | 2A-9042202 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA