
CAS Number38404-42-1
SynonymsBenzoic acid,3,4-dimethyl-,methyl ester; methyl ester of 3,4-dimethylbenzoic acid; 3,4-Dimethyl-benzoesaeure-methylester; MFCD00219861; 3,4-dimethyl-benzoic acid methyl ester; 5-Fluoro-pyridine-2-carbonitrile
Molecular FormulaC10H12O2
Molecular Weight164.21
Purity98.00%
Density1.027g/cm3
Boiling Point129 °C0.2 mm Hg(lit.)
Melting Point60-62 °C(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 38404-42-1 |
| Catalog No. | 2A-9042140 |
| Chinese Name | 3,4-二甲基苯甲酸甲酯 |
| Synonyms | Benzoic acid,3,4-dimethyl-,methyl ester; methyl ester of 3,4-dimethylbenzoic acid; 3,4-Dimethyl-benzoesaeure-methylester; MFCD00219861; 3,4-dimethyl-benzoic acid methyl ester; 5-Fluoro-pyridine-2-carbonitrile |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.21 |
| Purity | 98.00 |
| Density | 1.027g/cm3 |
| Boiling Point | 129 °C0.2 mm Hg(lit.) |
| Melting Point | 60-62 °C(lit.) |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2916399090 |
| PubChem ID | 3216463 |
| MDL Number | MFCD00219861 |
| SMILES | COC(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C10H12O2/c1-7-4-5-9(6-8(7)2)10(11)12-3/h4-6H,1-3H3 |
| InChI Key | PTSSKYUSCIALKU-UHFFFAOYSA-N |
| MSDS | msds/42140_1_38404_42_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,2,4-Tribromobutane | 38300-67-3 | 2A-9042124 |
| 1,8-Dibromopyrene | 38303-35-4 | 2A-9042125 |
| Potassium 3-methoxy-3-oxopropanoate | 38330-80-2 | 2A-9042131 |
| 3,5-Dimethylthiophenol | 38360-81-5 | 2A-9042134 |
| 3'-Acetoxy-2-bromoacetophenone | 38396-89-3 | 2A-9042138 |
| Ethyl 4-acetylbenzoate | 38430-55-6 | 2A-9042143 |
| 3-(Methylthio)hexanal | 38433-74-8 | 2A-9042144 |
| 1H,1H,2H,2H-Perfluorohexyl bromide | 38436-14-5 | 2A-9042145 |
| 2-Deoxy-2-fluoro-D-mannose | 38440-79-8 | 2A-9042147 |
| 4-(Hexyloxy)phenyl 4-butylbenzoate | 38454-28-3 | 2A-9042148 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA