
CAS Number672-75-3
Synonyms3-bromo-4-fluoro-benzoic acid chloride; 3-Brom-4-fluor-benzoylchlorid; 3-Bromo-4-fluoro-benzoyl chloride; GVR CF DE; MFCD04972690; 3-Bromo-4-fluorobenzoyl chloride; 3-Bromo-4-fluorobenzyl chloride; EINECS 211-596-9
Molecular FormulaC7H3BrClFO
Molecular Weight237.454
Purity98%
Density1.7±0.1 g/cm3
Boiling Point241.9±25.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 672-75-3 |
| Catalog No. | 2A-9004214 |
| Chinese Name | 3-溴-4-氟苯甲酰氯 |
| Synonyms | 3-bromo-4-fluoro-benzoic acid chloride; 3-Brom-4-fluor-benzoylchlorid; 3-Bromo-4-fluoro-benzoyl chloride; GVR CF DE; MFCD04972690; 3-Bromo-4-fluorobenzoyl chloride; 3-Bromo-4-fluorobenzyl chloride; EINECS 211-596-9 |
| Molecular Formula | C7H3BrClFO |
| Molecular Weight | 237.454 |
| Purity | 98 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 241.9±25.0 °C at 760 mmHg |
| Storage Condition | Room temperature, filled with argon |
| HTC | 2916399090 |
| SMILES | O=C(Cl)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C7H3BrClFO/c8-5-3-4(7(9)11)1-2-6(5)10/h1-3H |
| InChI Key | HPHZOCIBMCWXCQ-UHFFFAOYSA-N |
| MSDS | msds/4214_1_672_75_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Bromo-4'-fluoro-3'-methylbenzophenone | 844884-90-8 | 2A-9004207 |
| 3-Bromo-4-fluoroaniline | 656-64-4 | 2A-9004208 |
| 3-Bromo-4-fluorobenzoic acid | 1007-16-5 | 2A-9004211 |
| 3-Bromo-4-fluorobenzonitrile | 79630-23-2 | 2A-9004212 |
| 3-Bromo-4-fluorobenzotrifluoride | 68322-84-9 | 2A-9004213 |
| 3-Bromo-4-fluorobenzyl alcohol | 77771-03-0 | 2A-9004215 |
| 3-Bromo-4-fluorobenzylisocyanide | 728920-04-5 | 2A-9004216 |
| 3-Bromo-4'-fluorobiphenyl | 2A-104217 | 2A-9004217 |
| 3-Bromo-4-fluorocinnamic acid | 160434-49-1 | 2A-9004218 |
| 3-Bromo-4'-fluorodiphenyl ether | 50904-38-6 | 2A-9004219 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA