
CAS Number38076-80-1
Synonyms5-Chloro-2-hydroxynicotinic acid; MFCD00204158; 5-chloro-2-oxo-1H-pyridine-3-carboxylic acid; 5-chloro-2-hydroxypyridine-3-carboxylic acid; 5-Chloro-2-hydroxy-3-pyridinecarboxylic Acid
Molecular FormulaC6H4ClNO3
Molecular Weight173.56
Purity98.00%
Density1.6±0.1 g/cm3
Boiling Point424.5±45.0 °C at 760 mmHg
Melting Point260 °C
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 38076-80-1 |
| Catalog No. | 2A-9042067 |
| Chinese Name | 5-氯-2-羟基烟酸 |
| Synonyms | 5-Chloro-2-hydroxynicotinic acid; MFCD00204158; 5-chloro-2-oxo-1H-pyridine-3-carboxylic acid; 5-chloro-2-hydroxypyridine-3-carboxylic acid; 5-Chloro-2-hydroxy-3-pyridinecarboxylic Acid |
| Molecular Formula | C6H4ClNO3 |
| Molecular Weight | 173.56 |
| Purity | 98.00 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 424.5±45.0 °C at 760 mmHg |
| Melting Point | 260 °C |
| Appearance | solid |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2933399090 |
| PubChem ID | 3171096 |
| SMILES | O=C(O)c1cc(Cl)c[nH]c1=O |
| InChI | InChI=1S/C6H4ClNO3/c7-3-1-4(6(10)11)5(9)8-2-3/h1-2H,(H,8,9)(H,10,11)/p-1 |
| InChI Key | XBHXNMLFJZTSAS-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-6-hydroxynicotinic acid | 38025-90-0 | 2A-9042059 |
| 4-(Dimethylamino)tetrahydro-2H-pyran | 38035-10-8 | 2A-9042061 |
| 2-(Trimethylsiloxy)-1,3-butadiene | 38053-91-7 | 2A-9042064 |
| 1-Methylnaphthalene-D10 | 38072-94-5 | 2A-9042065 |
| 6-Chloro-2-hydroxynicotinic acid | 38076-76-5 | 2A-9042066 |
| Climbazole | 38083-17-9 | 2A-9042071 |
| 3-(4'-Methylbenzylidene)camphor | 38102-62-4 | 2A-9042075 |
| Bromodifluoroacetyl fluoride | 38126-07-7 | 2A-9042079 |
| 4-Methylvaleryl chloride | 38136-29-7 | 2A-9042080 |
| (E)-3-Cyano-3-(methylimino)-2-oxopropanoic acid | 38157-71-0 | 2A-9042082 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA