
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 37529-30-9 |
| Catalog No. | 2A-9041975 |
| Chinese Name | 4-癸基苯胺 |
| Synonyms | 4-n-Decylaniline; MFCD00007918; p-Decylaniline; ZR D10; 4-Decylaniline; EINECS 253-546-9 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.392 |
| Purity | 98.00 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 364.4±0.0 °C at 760 mmHg |
| Melting Point | 25 °C(lit.) |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2921420090 |
| SMILES | CCCCCCCCCCc1ccc(N)cc1 |
| InChI | InChI=1S/C16H27N/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(17)14-12-15/h11-14H,2-10,17H2,1H3 |
| InChI Key | WGENWPANMZLPIH-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Tetrabutyl ammonium chloride hydrate | 37451-68-6 | 2A-9041963 |
| 5,8-Dimethoxy-2-tetralone | 37464-90-7 | 2A-9041964 |
| Ethyl 3,4-diaminobenzoate | 37466-90-3 | 2A-9041966 |
| Acebutolol | 37517-30-9 | 2A-9041973 |
| Methyl malonyl chloride | 37517-81-0 | 2A-9041974 |
| L-4-Pyridylalanine | 37535-49-2 | 2A-9041976 |
| D-4-Pyridylalanine | 37535-50-5 | 2A-9041977 |
| 3-(2-Pyridyl)-L-alanine | 37535-51-6 | 2A-9041978 |
| 3-(2-Pyridyl)-D-alanine | 37535-52-7 | 2A-9041979 |
| 7-Amino-3-(1,2,3-triazol-4-ylthio)methyl cephalosporanic acid | 37539-03-0 | 2A-9041982 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA