
CAS Number37440-01-0
SynonymsAC-D-ALA(2-NAPH)-OH; AC-D-2-NAL-OH; N-acetyl-D-3-(2-naphthyl)alanine; (R)-2-Acetamido-3-(naphthalen-2-yl)propanoic acid; ACETYL-3-(2-NAPHTHYL)-D-ALANINE; N-Acetyl-3-(2-naphthyl)-D-alanine; AC-D-ALA(2-NAPHTHYL)-OH; (R)-N-acetyl-3-(2-naphthyl)alanine; N-acetyl-D-2-naphthylalanine; ACETYL-D-2-NAPHTHYLALANINE; AC-D-NAL(2)-OH; Ac-2-D-Nal-OH
Molecular FormulaC15H15NO3
Molecular Weight257.28400
Purity98.00%
Density1.241g/cm3
Boiling Point530.7ºC at 760 mmHg
AppearanceOff-white to light yellow-beige granular powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 37440-01-0 |
| Catalog No. | 2A-9041959 |
| Chinese Name | N-乙酰基-3-(2-萘基)-D-丙氨酸 |
| Synonyms | AC-D-ALA(2-NAPH)-OH; AC-D-2-NAL-OH; N-acetyl-D-3-(2-naphthyl)alanine; (R)-2-Acetamido-3-(naphthalen-2-yl)propanoic acid; ACETYL-3-(2-NAPHTHYL)-D-ALANINE; N-Acetyl-3-(2-naphthyl)-D-alanine; AC-D-ALA(2-NAPHTHYL)-OH; (R)-N-acetyl-3-(2-naphthyl)alanine; N-acetyl-D-2-naphthylalanine; ACETYL-D-2-NAPHTHYLALANINE; AC-D-NAL(2)-OH; Ac-2-D-Nal-OH |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.28400 |
| Purity | 98.00 |
| Density | 1.241g/cm3 |
| Boiling Point | 530.7ºC at 760 mmHg |
| Appearance | Off-white to light yellow-beige granular powder |
| Storage Condition | Sealed in a cool, dry environment at 2-8ºC |
| HTC | 2924299090 |
| SMILES | CC(=O)NC(Cc1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C15H15NO3/c1-10(17)16-14(15(18)19)9-11-6-7-12-4-2-3-5-13(12)8-11/h2-8,14H,9H2,1H3,(H,16,17)(H,18,19)/p-1/t14-/m1/s1 |
| InChI Key | HGTIILKZSFKZMS-CQSZACIVSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| (S)-2-Methylpiperidine-L-tartrate | 36702-48-4 | 2A-9041847 |
| N-(3-Indolylacetyl)-L-leucine | 36838-63-8 | 2A-9041869 |
| 2-Bromoquinoxaline | 36856-91-4 | 2A-9041874 |
| 7-Amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid diphenylmethyl ester | 36923-21-4 | 2A-9041884 |
| (S)-N-Acetyl-2-naphthylalanine | 37439-99-9 | 2A-9041958 |
| (R)-(-)-2-Chloropropan-1-ol | 37493-14-4 | 2A-9041969 |
| (S)-1-Chloro-2-propanol | 37493-16-6 | 2A-0201781 |
| (S)-N-Boc-(4-Pyridyl)alanine | 37535-57-2 | 2A-9041980 |
| (R)-N-Boc-(4-Pyridyl)alanine | 37535-58-3 | 2A-9041981 |
| (R)-Piperidine-3-carboxylic acid ethyl ester hydrochloride | 37675-19-7 | 2A-9041999 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA