
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 35295-35-3 |
| Catalog No. | 2A-9041663 |
| Chinese Name | 3-(1,1,2,2-四氟乙氧基)苯甲醛 |
| Synonyms | MFCD00039574; 3-tetrafluoroethoxybenzaldehyde; EINECS 252-496-5 |
| Molecular Formula | C9H6F4O2 |
| Molecular Weight | 222.13600 |
| Purity | 98.00 |
| Density | 1.393 g/mL at 25 °C(lit.) |
| Boiling Point | 95-97°C 9mm |
| Appearance | liquid |
| HTC | 2913000090 |
| SMILES | O=Cc1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C9H6F4O2/c10-8(11)9(12,13)15-7-3-1-2-6(4-7)5-14/h1-5,8H |
| InChI Key | LAFOZKQZOGJYKC-UHFFFAOYSA-N |
| MSDS | msds/41663_2_35295_35_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-Bromo-4-methoxybenzaldehyde | 34841-06-0 | 2A-9041560 |
| 3-Chloroadamantanecarboxylic acid | 34859-74-0 | 2A-9041569 |
| Selenophene-2-boronic acid | 35133-86-9 | 2A-9041614 |
| Chloromethyl ethyl carbonate | 35179-98-7 | 2A-9041632 |
| 6-(Chloromethyl)-2-phenylpyrimidin-4-ol | 35252-98-3 | 2A-9041651 |
| Trinonyl benzene-1,2,4-tricarboxylate | 35415-27-1 | 2A-9041685 |
| Cbz-beta-Amino-L-alanine | 35761-26-3 | 2A-9041704 |
| 2-Bromobenzaldehyde diethyl acetal | 35822-58-3 | 2A-9041712 |
| 4-(2-Pyridyl)thiosemicarbazide | 36273-89-9 | 2A-9041783 |
| Formaldehyde-2-naphthalenesulfonic acid copolymer sodium salt | 36290-04-7 | 2A-9041786 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA