
CAS Number35288-44-9
Synonyms4-n-propoxy-3-nitrobenzoic acid; Benzoic acid,3-nitro-4-propoxy; 3-Nitro-4-propoxy-benzoesaeure; 4-Propoxy-3-nitrobenzoic acid; 3-nitro-4-propoxy-benzoic acid; 3-nitro-4-(propyloxy)benzoic acid
Molecular FormulaC10H11NO5
Molecular Weight225.19800
Purity98.00%
Density1.318 g/cm3
Boiling Point387.3ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 35288-44-9 |
| Catalog No. | 2A-9041661 |
| Chinese Name | 3-硝基-4-丙氧基苯甲酸 |
| Synonyms | 4-n-propoxy-3-nitrobenzoic acid; Benzoic acid,3-nitro-4-propoxy; 3-Nitro-4-propoxy-benzoesaeure; 4-Propoxy-3-nitrobenzoic acid; 3-nitro-4-propoxy-benzoic acid; 3-nitro-4-(propyloxy)benzoic acid |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.19800 |
| Purity | 98.00 |
| Density | 1.318 g/cm3 |
| Boiling Point | 387.3ºC at 760 mmHg |
| HTC | 2918990090 |
| SMILES | CCCOc1ccc(C(=O)O)cc1[N+](=O)[O-] |
| InChI Key | NKACWRJUOBYVGP-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,5-Diphenylpenta-1,4-dien-3-one | 35225-79-7 | 2A-9041644 |
| (+/-)-2-Aminododecanoic acid | 35237-37-7 | 2A-9041648 |
| Hexadecyl lactate | 35274-05-6 | 2A-9041657 |
| Sodium ethyl p-hydroxybenzoate | 35285-68-8 | 2A-9041658 |
| Kudinoside H | 35286-58-9 | 2A-9041660 |
| 2-Methyl-4,5,6,7-tetrahydro-1H-indol-4-one | 35308-68-0 | 2A-9041667 |
| D-Alaninamide | 35320-22-0 | 2A-9041669 |
| N-(2-Hydroxypropyl)benzenesulphonamide | 35325-02-1 | 2A-9041672 |
| Dihydrofluorescein diacetate | 35340-49-9 | 2A-9041673 |
| Honokiol | 35354-74-6 | 2A-9041675 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA