
CAS Number34893-92-0
Synonyms3,5-DICHLOROISOCYANATOBENZENE; 3,5-Dichlorophenyl i; 3,5-Dichlorophenyl isocyanate; 3,5-dichlorobenzenisocyanate; 3,5-Dichlorophenylisocyantae; Benzene,1,3-dichloro-5-isocyanato; MFCD00013859; 1-Isocyanato-3,5-dichlorobenzene; 1,3-Dichloro-5-isocyanatobenzene; 3,4-dichlorophenyl isocyanate; Isocyanic Acid 3,5-Dichlorophenyl Ester; 4,5-Dichlorophenyl isocyanate; EINECS 252-276-9; 3,5-dichlorophenylisocyanate; 1,3-dichloro-5-isocyanato-benzen
Molecular FormulaC7H3Cl2NO
Molecular Weight188.011
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point264.2±30.0 °C at 760 mmHg
Melting Point32-34 °C(lit.)
AppearanceWhite or light yellow solid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 34893-92-0 |
| Catalog No. | 2A-9041574 |
| Chinese Name | 3,5-二氯苯异氰酸酯 |
| Synonyms | 3,5-DICHLOROISOCYANATOBENZENE; 3,5-Dichlorophenyl i; 3,5-Dichlorophenyl isocyanate; 3,5-dichlorobenzenisocyanate; 3,5-Dichlorophenylisocyantae; Benzene,1,3-dichloro-5-isocyanato; MFCD00013859; 1-Isocyanato-3,5-dichlorobenzene; 1,3-Dichloro-5-isocyanatobenzene; 3,4-dichlorophenyl isocyanate; Isocyanic Acid 3,5-Dichlorophenyl Ester; 4,5-Dichlorophenyl isocyanate; EINECS 252-276-9; 3,5-dichlorophenylisocyanate; 1,3-dichloro-5-isocyanato-benzen |
| Molecular Formula | C7H3Cl2NO |
| Molecular Weight | 188.011 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 264.2±30.0 °C at 760 mmHg |
| Melting Point | 32-34 °C(lit.) |
| Appearance | White or light yellow solid |
| Water Solubility | decomposes |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | II |
| HTC | 2929109000 |
| SMILES | O=C=Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C7H3Cl2NO/c8-5-1-6(9)3-7(2-5)10-4-11/h1-3H |
| InChI Key | XEFUJGURFLOFAN-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Item 1 Poisons. UN number: 2250 Official shipping name: Dichlorophenyl isocyanate Packing grade: II |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| (R)-2-Aminooctane | 34566-05-7 | 2A-9041487 |
| (S)-(+)-3-Quinuclidinol | 34583-34-1 | 2A-9041494 |
| 2-(4-Bromophenyl)imidazo[1,2-a]pyridine | 34658-66-7 | 2A-9041512 |
| 3-Amino-6,7-dimethoxy-4(3H)-quinazolinone | 34659-16-0 | 2A-9041513 |
| (R)-(-)-2-Amino-3-methylbutane | 34701-33-2 | 2A-9041523 |
| 5-Chloro-2-methylbenzenesulfonyl chloride | 34981-38-9 | 2A-9041590 |
| (S)-(-)-2-Methylbutylamine | 34985-37-0 | 2A-9041591 |
| (R)-3-Phenylcyclohexanone | 34993-51-6 | 2A-9041592 |
| (S)-2-Bromo-3-phenylpropionic acid | 35016-63-8 | 2A-9041599 |
| D-1-N-Boc-prolinamide | 35150-07-3 | 2A-9041622 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA