
CAS Number34698-41-4
Synonyms1-Aminoindan; INDAN-1-YLAMINE; 2,3-dihydro-1H-inden-1-amine; Indan-1-amine; EINECS 252-158-7; (n)-1-aminoindan; 1-Aminoinden; 1-Aminoindane; 1,3-dihydro-1H-inden-1-amine; 1-indanylamine; indane amine; MFCD00003799; 1-Iminoindane; 1-Indanamine; RS-(2,3-dihydro-1H-inden-1-yl)-amine; 1-AMINOHYDRINDENE
Molecular FormulaC9H11N
Molecular Weight133.190
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point225.0±19.0 °C at 760 mmHg
Melting Point15 °C(lit.)
Appearancedry powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 34698-41-4 |
| Catalog No. | 2A-9041522 |
| Chinese Name | 1-氨基二氢化茚 |
| Synonyms | 1-Aminoindan; INDAN-1-YLAMINE; 2,3-dihydro-1H-inden-1-amine; Indan-1-amine; EINECS 252-158-7; (n)-1-aminoindan; 1-Aminoinden; 1-Aminoindane; 1,3-dihydro-1H-inden-1-amine; 1-indanylamine; indane amine; MFCD00003799; 1-Iminoindane; 1-Indanamine; RS-(2,3-dihydro-1H-inden-1-yl)-amine; 1-AMINOHYDRINDENE |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.190 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 225.0±19.0 °C at 760 mmHg |
| Melting Point | 15 °C(lit.) |
| Appearance | dry powder |
| Water Solubility | insoluble |
| Storage Condition | Seal and store at 4ºC |
| HTC | 29214980 |
| SMILES | NC1CCc2ccccc21 |
| InChI | InChI=1S/C9H11N/c10-9-6-5-7-3-1-2-4-8(7)9/h1-4,9H,5-6,10H2/p+1/t9-/m0/s1 |
| InChI Key | XJEVHMGJSYVQBQ-UHFFFAOYSA-N |
| MSDS | msds/41522_2_34698_41_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Chloro-2-nitrobenzonitrile | 34662-31-2 | 2A-9041515 |
| Centpropazine | 34675-77-9 | 2A-9041518 |
| 2-Bromo-N-methylacetamide | 34680-81-4 | 2A-9041519 |
| Mesitylacetonitrile | 34688-71-6 | 2A-9041520 |
| Bis(hexamethylenetriaminepenta(methylenephosphonic acid)) | 34690-00-1 | 2A-9041521 |
| 3-Thiocyanatopropyltriethoxysilane | 34708-08-2 | 2A-9041525 |
| Magnesium oratate | 34717-03-8 | 2A-9041526 |
| 1-Methyl-4-piperidinol hydrochloride | 34737-83-2 | 2A-9041530 |
| 1-Benzyl-3-methyl-4-piperidone | 34737-89-8 | 2A-9041531 |
| 2-Phenoxyethyl chloroformate | 34743-87-8 | 2A-9041532 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA