
CAS Number34377-38-3
Synonyms3-Methylbutyl 2-hydroxybenzoate; isopentyl 2-hydroxybenzoate; 2-hydroxybenzoic acid isopentyl ester; 2-hydroxybenzoic acid isoamyl ester; 2-Hydroxybenzoic acid, 3-methylbutyl ester
Molecular FormulaC12H16O3
Molecular Weight208.25400
Purity98.00%
Density1.05 g/mL at 25ºC(lit.)
Boiling Point277-278ºC(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 34377-38-3 |
| Catalog No. | 2A-9041450 |
| Chinese Name | 水杨酸异戊酯 |
| Synonyms | 3-Methylbutyl 2-hydroxybenzoate; isopentyl 2-hydroxybenzoate; 2-hydroxybenzoic acid isopentyl ester; 2-hydroxybenzoic acid isoamyl ester; 2-Hydroxybenzoic acid, 3-methylbutyl ester |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.25400 |
| Purity | 98.00 |
| Density | 1.05 g/mL at 25ºC(lit.) |
| Boiling Point | 277-278ºC(lit.) |
| HTC | 2918230000 |
| SMILES | CC(C)CCOC(=O)c1ccccc1O |
| InChI | InChI=1S/C12H16O3/c1-9(2)7-8-15-12(14)10-5-3-4-6-11(10)13/h3-6,9,13H,7-8H2,1-2H3 |
| InChI Key | InChIKey=PMGCQNGBLMMXEW-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918230000 other esters of salicylic acid and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (4-Methyl-2-phenyl-1,3-thiazol-5-yl)acetic acid | 34272-67-8 | 2A-9041429 |
| Poly(glycolide-lactide) | 34346-01-5 | 2A-9041440 |
| 1-Methyl-3-phenyl-1H-pyrazol-5-ol | 34347-81-4 | 2A-9041441 |
| 2'-(Dibenzylamino)-6'-(diethylamino)fluoran | 34372-72-0 | 2A-9041446 |
| 6-Methoxy-N-ethylquinolinium iodide | 34373-76-7 | 2A-9041447 |
| 4-(Methylaminomethyl)benzonitrile | 34403-48-0 | 2A-9041460 |
| Lathyrol | 34420-19-4 | 2A-9041464 |
| [5-[2-(3-Ethyl-3H-benzothiazol-2-ylidene)-1-methylethylidene]-4-oxo-2-thioxothiazolidin-3-yl]acetic acid | 34431-79-3 | 2A-9041466 |
| tert-Butylperoxy 2-ethylhexyl carbonate | 34443-12-4 | 2A-9041467 |
| Sucrose acetate isobutyrate | 34482-63-8 | 2A-9041470 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA