
CAS Number34068-01-4
SynonymsEINECS 251-816-0; 1-(3-(Benzyloxy)phenyl)ethanone; MFCD06797452
Molecular FormulaC15H14O2
Molecular Weight226.27000
Purity98.00%
Density1.1 g/cm3
Boiling Point354ºC at 760 mmHg
Melting Point200-203 °C(lit.)
AppearanceLight yellow low melting point solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 34068-01-4 |
| Catalog No. | 2A-9041384 |
| Chinese Name | 3-苄氧基苯乙酮 |
| Synonyms | EINECS 251-816-0; 1-(3-(Benzyloxy)phenyl)ethanone; MFCD06797452 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27000 |
| Purity | 98.00 |
| Density | 1.1 g/cm3 |
| Boiling Point | 354ºC at 760 mmHg |
| Melting Point | 200-203 °C(lit.) |
| Appearance | Light yellow low melting point solid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2914509090 |
| SMILES | CC(=O)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C15H14O2/c1-12(16)14-8-5-9-15(10-14)17-11-13-6-3-2-4-7-13/h2-10H,11H2,1H3 |
| InChI Key | FGQMEAWGAUALJQ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Auranofin | 34031-32-8 | 2A-9041371 |
| 5-(4-Chlorophenyl)furfural | 34035-03-5 | 2A-9041372 |
| Phenyltris(methylethylketoximio)silane | 34036-80-1 | 2A-9041374 |
| Ethyl 2-formylbenzoate | 34046-43-0 | 2A-9041378 |
| 4-Methylthio-2-butanone | 34047-39-7 | 2A-9041379 |
| Methyl phenylsulfonylacetate | 34097-60-4 | 2A-9041390 |
| 4-Chloro-3-hydroxybenzoic acid | 34113-69-4 | 2A-9041394 |
| 3-Nitrophenyl ethyl sulfide | 34126-43-7 | 2A-9041396 |
| Decatol | 34131-99-2 | 2A-9041397 |
| Methyl allyl trisulfide | 34135-85-8 | 2A-9041398 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA