
CAS Number33763-20-1
Synonyms4-Methyl-2-phenyl-thiazole-5-carboxylic acid; 4-methyl-2-(phenyl)-1,3-thiazol-5-carboxylic acid; 2-phenyl-4-methylthlazole-5-carboxylic acid; 4-methyl-2-phenyl-5-thiazolecarboxylic acid; 4-Methyl-2-phenyl-thiazol-5-carbonsaeure; MFCD00141955; 4-methyl-2-phenylthiazol-5-carboxylic acid; 5-thiazolecarboxylic acid,4-methyl-2-phenyl
Molecular FormulaC11H9NO2S
Molecular Weight219.26000
Purity98.00%
Density1.319g/cm3
Boiling Point424ºC at 760mmHg
Melting Point210-212°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 33763-20-1 |
| Catalog No. | 2A-9041325 |
| Chinese Name | 4-甲基-2-苯基-1,3-噻唑-5-羧酸 |
| Synonyms | 4-Methyl-2-phenyl-thiazole-5-carboxylic acid; 4-methyl-2-(phenyl)-1,3-thiazol-5-carboxylic acid; 2-phenyl-4-methylthlazole-5-carboxylic acid; 4-methyl-2-phenyl-5-thiazolecarboxylic acid; 4-Methyl-2-phenyl-thiazol-5-carbonsaeure; MFCD00141955; 4-methyl-2-phenylthiazol-5-carboxylic acid; 5-thiazolecarboxylic acid,4-methyl-2-phenyl |
| Molecular Formula | C11H9NO2S |
| Molecular Weight | 219.26000 |
| Purity | 98.00 |
| Density | 1.319g/cm3 |
| Boiling Point | 424ºC at 760mmHg |
| Melting Point | 210-212°C |
| Storage Condition | 2-8°C, dry and sealed |
| HTC | 2934100090 |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)O |
| InChI | InChI=1S/C11H9NO2S/c1-7-9(11(13)14)15-10(12-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,13,14)/p-1 |
| InChI Key | CRSMRBYEBHOYRM-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| Ethyl imidazole-2-carboxylate | 33543-78-1 | 2A-9041288 |
| 4-Hydrazino-3-nitropyridine | 33544-42-2 | 2A-9041290 |
| 1-Methyl-6-oxo-1,4,5,6-tetrahydropyridazine-3-carboxylic acid | 33548-32-2 | 2A-9041291 |
| 3,4-Diamino-2-hydroxypyridine | 33631-02-6 | 2A-9041307 |
| 2-Methylamino-3-nitro-6-chloropyridine | 33742-70-0 | 2A-9041321 |
| 2-(2-Bromoethyl)-1,3-dioxane | 33884-43-4 | 2A-9041344 |
| [(Thiophene-2-carbonyl)amino]acetic acid | 33955-17-8 | 2A-9041357 |
| 1-Oxo-1,2-dihydro-4-isoquinolinecarboxylic acid | 34014-51-2 | 2A-9041369 |
| (3S)-3-Aminodihydro-2,5-furandione hydrochloride | 34029-31-7 | 2A-9041370 |
| 1,3-Bis(4,5-dihydro-2-oxazolyl)benzene | 34052-90-9 | 2A-9041382 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA