
CAS Number33719-74-3
Synonyms3,5-DICHLOROANISOL; MFCD00000589; 1,3-Dichloro-5-methoxybenzene; EINECS 251-655-6; Methyl-(3.5-dichlor-phenyl)-aether; 3,5-dichloro-anisole; 3.5-Dichlor-1-methoxy-benzol; Benzene,3,5-dichloro-1-methoxy; 3,5-dichlorophenol anisole; 3,5-Dichlor-anisol; 3,5-Dichlorophenyl methyl ether; 3,5-Dichloroanisole
Molecular FormulaC7H6Cl2O
Molecular Weight177.028
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point223.6±20.0 °C at 760 mmHg
Melting Point39-41 °C (dec.)(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 33719-74-3 |
| Catalog No. | 2A-9041317 |
| Chinese Name | 3,5-二氯苯甲醚 |
| Synonyms | 3,5-DICHLOROANISOL; MFCD00000589; 1,3-Dichloro-5-methoxybenzene; EINECS 251-655-6; Methyl-(3.5-dichlor-phenyl)-aether; 3,5-dichloro-anisole; 3.5-Dichlor-1-methoxy-benzol; Benzene,3,5-dichloro-1-methoxy; 3,5-dichlorophenol anisole; 3,5-Dichlor-anisol; 3,5-Dichlorophenyl methyl ether; 3,5-Dichloroanisole |
| Molecular Formula | C7H6Cl2O |
| Molecular Weight | 177.028 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 223.6±20.0 °C at 760 mmHg |
| Melting Point | 39-41 °C (dec.)(lit.) |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2909309090 |
| SMILES | COc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C7H6Cl2O/c1-10-7-3-5(8)2-6(9)4-7/h2-4H,1H3 |
| InChI Key | SSNXYMVLSOMJLU-UHFFFAOYSA-N |
| MSDS | msds/41317_2_33719_74_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Histidylprolineamide | 33605-69-5 | 2A-9041301 |
| 3-Amino-2-pyridinol | 33630-99-8 | 2A-9041306 |
| 2,4,6-Trimethyldiphenyl sulfide | 33667-80-0 | 2A-9041312 |
| Diisononyl adipate | 33703-08-1 | 2A-9041315 |
| 1,2,3,5,6,7-Hexahydro-1,1,2,3,3-pentamethyl-4H-inden-4-one | 33704-61-9 | 2A-9041316 |
| Tetrabutylammonium borohydride | 33725-74-5 | 2A-9041318 |
| Amino(naphthalen-2-yl)acetic acid | 33741-78-5 | 2A-9041320 |
| Heptyl chloroformate | 33758-34-8 | 2A-9041324 |
| 5-Bromobenzene-1,3-diamine | 33786-90-2 | 2A-9041327 |
| N,N-Dimethylmethyleneiminium iodide | 33797-51-2 | 2A-9041329 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA