
CAS Number32432-55-6
SynonymsEINECS 251-039-7; 2,4-Diamino-3,5-dimethyl-6-sulfotoluene; 2,4-diaminomesitylene-6-sulfonic acid; 3,5-Diamino-2,4,6-trimethylbenzenesulfonic acid; MFCD00002525; EINECS 207-876-5; 3,5-Diamino-2,4,6-trimethylbenzenesulphonic acid; 2,6-Diaminomesitylene-4-sulfonic Acid; Benzenesulfonic acid,3,5-diamino-2,4,6-trimethyl; 5-amino-2,4,6-trimethyl-aniline-3-sulfonic acid; 3,5-diamino-2,4,6-trimethyl-benzenesulfonic acid; 2,4,6-Trimethyl-3,5-diaminobenzenesulfonic Acid; 3,5-Diamino-2,4,6-trimethyl-benzolsulfonsaeure; Diaminomesitylenesulfonic acid
Molecular FormulaC9H14N2O3S
Molecular Weight230.284
Purity98.00%
Density1.4±0.1 g/cm3
Melting Point169-171ºC(lit.)
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 32432-55-6 |
| Catalog No. | 2A-9041051 |
| Chinese Name | 2,4,6-三甲基-3,5-二氨基苯磺酸 |
| Synonyms | EINECS 251-039-7; 2,4-Diamino-3,5-dimethyl-6-sulfotoluene; 2,4-diaminomesitylene-6-sulfonic acid; 3,5-Diamino-2,4,6-trimethylbenzenesulfonic acid; MFCD00002525; EINECS 207-876-5; 3,5-Diamino-2,4,6-trimethylbenzenesulphonic acid; 2,6-Diaminomesitylene-4-sulfonic Acid; Benzenesulfonic acid,3,5-diamino-2,4,6-trimethyl; 5-amino-2,4,6-trimethyl-aniline-3-sulfonic acid; 3,5-diamino-2,4,6-trimethyl-benzenesulfonic acid; 2,4,6-Trimethyl-3,5-diaminobenzenesulfonic Acid; 3,5-Diamino-2,4,6-trimethyl-benzolsulfonsaeure; Diaminomesitylenesulfonic acid |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.284 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Melting Point | 169-171ºC(lit.) |
| Appearance | solid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2921519090 |
| SMILES | Cc1c(N)c(C)c(S(=O)(=O)O)c(C)c1N |
| InChI | InChI=1S/C9H14N2O3S/c1-4-7(10)5(2)9(15(12,13)14)6(3)8(4)11/h10-11H2,1-3H3,(H,12,13,14)/p-1 |
| InChI Key | PKKGGWLTUCMSSD-UHFFFAOYSA-N |
| MSDS | msds/41051_2_32432_55_6.pdf |
| Tax Rebate | 17.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 3,5-Diamino-2,4,6-trimethylbenzenesulfonic acid Modification number: 2 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Pentylcyclohexan-1-one | 32362-97-3 | 2A-9041037 |
| Benzyl thioacetate | 32362-99-5 | 2A-9041038 |
| Sisomicin | 32385-11-8 | 2A-9041040 |
| Acetyl cedrene | 32388-55-9 | 2A-9041042 |
| 2-Bromo-N-(2-methoxyphenyl)acetamide | 32428-69-6 | 2A-9041048 |
| 2-Bromo-N-(2,6-dimethylphenyl)acetamide | 32433-61-7 | 2A-9041052 |
| 4,4'-Dicyanobenzophenone | 32446-66-5 | 2A-9041054 |
| 4-Hydroxy-L-phenylglycine | 32462-30-9 | 2A-9041060 |
| Carbon-13C tetrachloride | 32488-50-9 | 2A-9041063 |
| N-Carbethoxy-4-tropinone | 32499-64-2 | 2A-9041065 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA