
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 522-70-3 |
| Catalog No. | 2A-9041017 |
| Chinese Name | 抗霉素A |
| Synonyms | antimycina3; ioxonan-3-yl)-3-formamidosalicylamide,stereoisomer; Blastmycin |
| Molecular Formula | C26H36N2O9 |
| Molecular Weight | 520.57200 |
| Purity | 98.00 |
| Density | 1.25g/cm3 |
| Boiling Point | 745.5ºC at 760mmHg |
| Storage Condition | Seal and store in a dry place below 0℃. |
| Packaging | II |
| Application | Antimycin A3 is an antibiotic isolated from various Streptomyces species and has antifungal activity. Antimycin A3 is a potent respiration inhibitor. Antimycin A3 inhibits the electron transfer activi |
| SMILES | CCCCC1C(=O)OC(C)C(NC(=O)c2cccc(NC=O)c2O)C(=O)OC(C)C1OC(=O)CC(C)C |
| InChI | InChI=1S/C26H36N2O9/c1-6-7-9-18-23(37-20(30)12-14(2)3)16(5)36-26(34)21(15(4)35-25(18)33)28-24(32)17-10-8-11-19(22(17)31)27-13-29/h8,10-11,13-16,18,21,23,31H,6-7,9,12H2,1-5H3,(H,27,29)(H,28,32)/t15-,16+,18-,21+,23+/m1/s1 |
| InChI Key | PVEVXUMVNWSNIG-PDPGNHKXSA-N |
| Hazard Symbols | 6.1(a) |
| Transport Info | Product name: Antimycin A3 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Acetyl-4-piperidone | 32161-06-1 | 2A-9041007 |
| Sodium N-hexadecanoyl-L-valinate | 32190-54-8 | 2A-9041012 |
| Sodium N-hexadecanoyl-L-phenlyalaninate | 32190-55-9 | 2A-9041013 |
| 4-tert-Butylcyclohexyl acetate | 32210-23-4 | 2A-9041014 |
| Dimethyl L-aspartate hydrochloride | 32213-95-9 | 2A-9041015 |
| (-)-Corey lactone diol | 32233-40-2 | 2A-9041019 |
| Methyl 3-cyclopropyl-3-oxopropionate | 32249-35-7 | 2A-9041024 |
| 4-Mercapto-2-methylphenol | 32281-01-9 | 2A-9041025 |
| 7-Bromo-1-tetralone | 32281-97-3 | 2A-9041026 |
| Poly(hexamethylenebiguanide) hydrochloride | 32289-58-0 | 2A-9041027 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA