
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 31827-94-8 |
| Catalog No. | 2A-9040954 |
| Chinese Name | 2-溴-4'-碘苯乙酮 |
| Synonyms | 4-Iodophenacyl bromide |
| Molecular Formula | C8H6BrIO |
| Molecular Weight | 324.94100 |
| Purity | 98.00 |
| Density | 2.08g/cm3 |
| Boiling Point | 328.7ºC at 760mmHg |
| Storage Condition | 2-8°C, protected from light, stored in inert gas |
| HTC | 2914700090 |
| SMILES | O=C(CBr)c1ccc(I)cc1 |
| InChI | InChI=1S/C8H6BrIO/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4H,5H2 |
| InChI Key | FSIBMLJFLPWMTD-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,13-Dibromotridecane | 31772-05-1 | 2A-9040943 |
| 2-Chloro-6-(4-fluorophenyl)nicotinonitrile | 31776-83-7 | 2A-9040946 |
| 2H-Cinnolin-3-one | 31777-46-5 | 2A-9040947 |
| 2-Bromo-6-methoxybenzoic acid | 31786-45-5 | 2A-9040949 |
| N,N-Dimethylethanamine N-oxide | 31820-06-1 | 2A-9040953 |
| Poly(trimethylene carbonate) | 31852-84-3 | 2A-9040957 |
| 5-Methyl-L-norleucine | 31872-98-7 | 2A-9040961 |
| Butylferrocene | 31904-29-7 | 2A-9040966 |
| Lyral | 31906-04-4 | 2A-9040967 |
| 2-Fluorobenzoylacetonitrile | 31915-26-1 | 2A-9040968 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA