
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 31139-87-4 |
| Catalog No. | 2A-9040841 |
| Chinese Name | 羟苯酰苯酸替培啶 |
| Synonyms | Asverin (TN); EINECS 250-481-8; Tipepidine hibenzate (JP16); Antupex(Tipepidine hibenzate); tipepidine hibenzate; I01-0288 |
| Molecular Formula | C29H27NO4S2 |
| Molecular Weight | 517.65900 |
| Purity | 98.00 |
| Density | 1.193g/cm3 |
| Boiling Point | 403ºC at 760mmHg |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2934999090 |
| SMILES | CN1CCCC(=C(c2cccs2)c2cccs2)C1.O=C(O)c1ccccc1C(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H17NS2.C14H10O4/c1-16-8-2-5-12(11-16)15(13-6-3-9-17-13)14-7-4-10-18-14;15-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)14(17)18/h3-4,6-7,9-10H,2,5,8,11H2,1H3;1-8,15H,(H,17,18) |
| InChI Key | KEEAAKGKVVTPOM-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Metrizamide | 31112-62-6 | 2A-9040834 |
| 2,2'-Dichlorodiphenyl disulfide | 31121-19-4 | 2A-9040835 |
| Rhodium(II) trifluoroacetate dimer | 31126-95-1 | 2A-9040836 |
| Sodium glucoheptonate | 31138-65-5 | 2A-9040839 |
| Dibenzyl dicarbonate | 31139-36-3 | 2A-9040840 |
| 5,6-Dihydro-7H-cyclopenta[b]pyridin-7-one | 31170-78-2 | 2A-9040847 |
| D-Xylose | 31178-70-8 | 2A-9040848 |
| 2,3-Dihydro-6,7-dimethoxy-4H-1-benzothiopyran-4-one | 31189-07-8 | 2A-9040854 |
| Fluotrimazol | 31251-03-3 | 2A-9040860 |
| Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) | 31277-98-2 | 2A-9040864 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA