
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 30879-49-3 |
| Catalog No. | 2A-9040793 |
| Chinese Name | 2-硝基-5-羟基苯乙酮 |
| Synonyms | 1-acetyl-5-hydroxy-2-nitrobenzene; PHQWMZYOGOPUIN-UHFFFAOYSA |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.14500 |
| Purity | 98.00 |
| Density | 1.38 |
| Boiling Point | 391.2ºC at 760 mmHg |
| Appearance | solid |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2914700090 |
| SMILES | CC(=O)c1cc(O)ccc1[N+](=O)[O-] |
| InChI Key | PHQWMZYOGOPUIN-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Dimethylaminonicotinic acid | 30766-20-2 | 2A-9040784 |
| Methyl 5-hydroxynicotinate | 30766-22-4 | 2A-9040785 |
| 1,4-Dibromo-2-butylene | 30794-77-5 | 2A-9040786 |
| 1,2,3,4-Tetrahydroisoquinolin-7-ol | 30798-64-2 | 2A-9040787 |
| 1-(4-Nitrophenyl)-3-pyrrolidino-2-pyrazolin-5-one | 30818-17-8 | 2A-9040788 |
| Flupentixol decanoate | 30909-51-4 | 2A-9040794 |
| Polyinosinic acid | 30918-54-8 | 2A-9040795 |
| Phenol novolac cyanate ester | 30944-92-4 | 2A-9040800 |
| Nickel bis[monoethyl(3,5-di-tert-butyl-4-hydroxylbenzyl)phosphonate] | 30947-30-9 | 2A-9040801 |
| Perillartine | 30950-27-7 | 2A-9040802 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA