
CAS Number30389-25-4
Synonyms1H,1H,2H-heneicosafluoro-dodec-1-ene; EINECS 250-173-3; 1H,1H,2H-perfluoro-1-dodecene; 1H,1H,2H-Perfluorododec-1-ene; 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecene; MFCD00042346
Molecular FormulaC12H3F21
Molecular Weight546.11900
Purity98.00%
Density1,711 g/cm3
Boiling Point71-72°C 14mm
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 30389-25-4 |
| Catalog No. | 2A-9040721 |
| Chinese Name | 全氟癸基乙烯 |
| Synonyms | 1H,1H,2H-heneicosafluoro-dodec-1-ene; EINECS 250-173-3; 1H,1H,2H-perfluoro-1-dodecene; 1H,1H,2H-Perfluorododec-1-ene; 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecene; MFCD00042346 |
| Molecular Formula | C12H3F21 |
| Molecular Weight | 546.11900 |
| Purity | 98.00 |
| Density | 1,711 g/cm3 |
| Boiling Point | 71-72°C 14mm |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2903399090 |
| SMILES | C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H3F21/c1-2-3(13,14)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)9(25,26)10(27,28)11(29,30)12(31,32)33/h2H,1H2 |
| InChI Key | UCHSAVGOZUCXHC-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2903399090. Brominated, fluorinated or iodinated derivatives of acyclic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Propargyl-3-sulfopropyl ether sodium salt | 30290-53-0 | 2A-9040707 |
| Tetrabutylphosphonium acetate | 30345-49-4 | 2A-9040712 |
| (2E,4E)-2,4-Octadienal | 30361-28-5 | 2A-9040714 |
| trans,trans-2,4-Undecadienal | 30361-29-6 | 2A-9040715 |
| Benzyloxyacetic acid | 30379-55-6 | 2A-9040717 |
| Methyl 3-oxohexanoate | 30414-54-1 | 2A-9040723 |
| Ethyl propyl disulphide | 30453-31-7 | 2A-9040728 |
| 8-Gingerol | 30462-35-2 | 2A-9040729 |
| 8-Methyl-7H-purin-6-ol | 30467-02-8 | 2A-9040732 |
| Tetrachloro[2.2]paracyclophane | 30501-29-2 | 2A-9040739 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA