
CAS Number30318-99-1
Synonyms3-Bromo-4-methylthiophene; 3-bromo-4-methyl thiophene; 3-BroMo-4-Methylthiophene 1GR; 3-Methyl-4-bromothiophene; 3-Brom-4-methyl-thiophen; MFCD00130084; 3-Br-4-Me-thiophene
Molecular FormulaC5H5BrS
Molecular Weight177.062
Purity95.00%
Density1.6±0.1 g/cm3
Boiling Point181.0±20.0 °C at 760 mmHg
AppearanceTransparent colorless to yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 30318-99-1 |
| Catalog No. | 2A-9040710 |
| Chinese Name | 3-溴-4-甲基噻吩 |
| Synonyms | 3-Bromo-4-methylthiophene; 3-bromo-4-methyl thiophene; 3-BroMo-4-Methylthiophene 1GR; 3-Methyl-4-bromothiophene; 3-Brom-4-methyl-thiophen; MFCD00130084; 3-Br-4-Me-thiophene |
| Molecular Formula | C5H5BrS |
| Molecular Weight | 177.062 |
| Purity | 95.00 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 181.0±20.0 °C at 760 mmHg |
| Appearance | Transparent colorless to yellow liquid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2934999090 |
| SMILES | Cc1cscc1Br |
| InChI | InChI=1S/C5H5BrS/c1-4-2-7-3-5(4)6/h2-3H,1H3 |
| InChI Key | MBUSOPVRLCFJCS-UHFFFAOYSA-N |
| MSDS | msds/40710_2_30318_99_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-Chloro-6-nitroquinoline | 29969-57-1 | 2A-9040670 |
| Ethyl 1-methyl-1H-imidazole-2-carboxylate | 30148-21-1 | 2A-9040692 |
| 1,3-Thiazole-2-carbonyl chloride | 30216-57-0 | 2A-9040698 |
| 4-Chloro-6-methylpyridine-2-carboxylic acid | 30235-19-9 | 2A-9040701 |
| 2-Amino-4-(3-pyridyl)thiazole | 30235-27-9 | 2A-9040703 |
| 3-Bromo-2-methylthiophene | 30319-05-2 | 2A-9040711 |
| 2,3,5-Tri-O-benzoyl-2-C-methyl-D-ribofuranose | 30361-17-2 | 2A-9040713 |
| 5-Aminooxazole-4-carboxamide | 30380-27-9 | 2A-9040718 |
| 4-Methylthieno[3,2-c]pyridine | 30433-78-4 | 2A-9040725 |
| 4-(4-Bromophenyl)morpholine | 30483-75-1 | 2A-9040733 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA