
CAS Number30235-26-8
Synonyms4-pyridin-2-yl-thiazol-2-ylamine; 4-(pyridin-2-yl)-1,3-thiazol-2-amine; 4-(Pyridin-2-yl)thiazol-2-amine; 4-(2-Pyridinyl)-1,3-thiazol-2-amine; 4-(Pyridin-2-yl)thiazol-2-yl]amine
Molecular FormulaC8H7N3S
Molecular Weight177.226
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point383.6±17.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 30235-26-8 |
| Catalog No. | 2A-9040702 |
| Chinese Name | 4-(吡啶-2-基)噻唑-2-胺 |
| Synonyms | 4-pyridin-2-yl-thiazol-2-ylamine; 4-(pyridin-2-yl)-1,3-thiazol-2-amine; 4-(Pyridin-2-yl)thiazol-2-amine; 4-(2-Pyridinyl)-1,3-thiazol-2-amine; 4-(Pyridin-2-yl)thiazol-2-yl]amine |
| Molecular Formula | C8H7N3S |
| Molecular Weight | 177.226 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 383.6±17.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, protected from light, dry and sealed |
| HTC | 2934100090 |
| SMILES | Nc1nc(-c2ccccn2)cs1 |
| InChI | InChI=1S/C8H7N3S/c9-8-11-7(5-12-8)6-3-1-2-4-10-6/h1-5H,(H2,9,11) |
| InChI Key | BLKHMTAXNXLDJP-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(4-Phenylbutoxy)benzoic acid | 30131-16-9 | 2A-9040691 |
| 3-Bromophenylalanine | 30163-20-3 | 2A-9040693 |
| Phenyladamantane | 30176-62-6 | 2A-9040695 |
| 4'-Bromo-2'-hydroxyacetophenone | 30186-18-6 | 2A-9040696 |
| 5-Methylgramine | 30218-58-7 | 2A-9040699 |
| Amineptine hydrochloride | 30272-08-3 | 2A-9040704 |
| 4-Bromo-2-chloro-6-methylaniline | 30273-42-8 | 2A-9040706 |
| Propargyl-3-sulfopropyl ether sodium salt | 30290-53-0 | 2A-9040707 |
| Tetrabutylphosphonium acetate | 30345-49-4 | 2A-9040712 |
| (2E,4E)-2,4-Octadienal | 30361-28-5 | 2A-9040714 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA