
CAS Number28978-02-1
Synonyms5-hydroxy-6-methoxy-2-(4-methoxyphenyl); neolinarin; Pectolinaroside; Pectolinarigenin 7-Rutinoside; PECTOLINARIN(P); Pectolinarin; pectolinarigenin 7-O-rutinoside
Molecular FormulaC29H34O15
Molecular Weight622.571
Purity98.00%
Density1.6±0.1 g/cm3
Boiling Point896.4±65.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 28978-02-1 |
| Catalog No. | 2A-9040497 |
| Chinese Name | 大蓟苷 |
| Synonyms | 5-hydroxy-6-methoxy-2-(4-methoxyphenyl); neolinarin; Pectolinaroside; Pectolinarigenin 7-Rutinoside; PECTOLINARIN(P); Pectolinarin; pectolinarigenin 7-O-rutinoside |
| Molecular Formula | C29H34O15 |
| Molecular Weight | 622.571 |
| Purity | 98.00 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 896.4±65.0 °C at 760 mmHg |
| Storage Condition | 2~8℃ |
| Application | Pectolinarin is isolated from Cirsium chanroenicum and has anti-inflammatory activity. Pectolinarin inhibits IL-6 and IL-8 secretion as well as PGE2 and NO production. Pectolinarin can inhibit cell pr |
| HTC | 29389090 |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)c(OC)c(OC4OC(COC5OC(C)C(O)C(O)C5O)C(O)C(O)C4O)cc3o2)cc1 |
| InChI | InChI=1S/C29H34O15/c1-11-20(31)23(34)25(36)28(41-11)40-10-18-21(32)24(35)26(37)29(44-18)43-17-9-16-19(22(33)27(17)39-3)14(30)8-15(42-16)12-4-6-13(38-2)7-5-12/h4-9,11,18,20-21,23-26,28-29,31-37H,10H2,1-3H3/t11-,18+,20-,21+,23+,24-,25+,26+,28+,29+/m0/s1 |
| InChI Key | DUXQKCCELUKXOE-CBBZIXHGSA-N |
| Transport Info | Product name: Isoside |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| 10-Methoxyiminostilbene-5-carbonylchloride | 28721-08-6 | 2A-9040444 |
| 1,4-Difluoroanthraquinone | 28736-42-7 | 2A-9040450 |
| Fraxinellone | 28808-62-0 | 2A-9040461 |
| Lithospermic acid | 28831-65-4 | 2A-9040465 |
| Dihydro-1,4,5,8-tetrahydroxyanthraquinone | 28932-22-1 | 2A-9040485 |
| Octyl-beta-D-glucopyranoside | 29836-26-8 | 2A-9040635 |
| Isocoptisine sulfate | 30462-71-6 | 2A-9040730 |
| (20S)-Protopanaxadiol | 30636-90-9 | 2A-9040757 |
| Methyl-beta-D-thioglucopyranoside | 30760-09-9 | 2A-9040780 |
| 1.3 Dicaffeoylquinic acid | 30964-13-7 | 2A-9040804 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA