
CAS Number28768-32-3
Synonymstetraglycidylmethylene dianiline; 4,4'-Methylenebis(N,N-diglycidylaniline); MFCD00661161; 4,4'-tetradiglycidyl diaminodiphenyl methane; N,N,N',N'-tetraglycidyl-4,4'-diaminodiphenylmethane; EINECS 249-204-3; Tetraglycidyl diaminosiphenyl methane
Molecular FormulaC25H30N2O4
Molecular Weight422.51700
Purity98.00%
Density1.15
Boiling Point619.3ºC at 760mmHg
AppearanceLiquid;Light yellow to Brown clear liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 28768-32-3 |
| Catalog No. | 2A-9040452 |
| Chinese Name | N,N,N,N,-四环氧丙基-4,4-二氨基二苯甲烷 |
| Synonyms | tetraglycidylmethylene dianiline; 4,4'-Methylenebis(N,N-diglycidylaniline); MFCD00661161; 4,4'-tetradiglycidyl diaminodiphenyl methane; N,N,N',N'-tetraglycidyl-4,4'-diaminodiphenylmethane; EINECS 249-204-3; Tetraglycidyl diaminosiphenyl methane |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.51700 |
| Purity | 98.00 |
| Density | 1.15 |
| Boiling Point | 619.3ºC at 760mmHg |
| Appearance | Liquid;Light yellow to Brown clear liquid |
| Storage Condition | Keep receptacles sealed Place in a tight container |
| HTC | 2921590090 |
| SMILES | c1cc(N(CC2CO2)CC2CO2)ccc1Cc1ccc(N(CC2CO2)CC2CO2)cc1 |
| InChI | InChI=1S/C25H30N2O4/c1-5-20(26(10-22-14-28-22)11-23-15-29-23)6-2-18(1)9-19-3-7-21(8-4-19)27(12-24-16-30-24)13-25-17-31-25/h1-8,22-25H,9-17H2 |
| InChI Key | FAUAZXVRLVIARB-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-Nitro-2-benzothiazolinone | 28620-12-4 | 2A-9040432 |
| Aniline Blue | 28631-66-5 | 2A-9040433 |
| 6-Amino-3,4-methylenedioxyacetophenone | 28657-75-2 | 2A-9040435 |
| 1H-1,2,4-Triazol-1-ylacetic acid | 28711-29-7 | 2A-9040440 |
| 5-Bromonicotinamide | 28733-43-9 | 2A-9040447 |
| 2,2-Difluoropropionic acid ethyl ester | 28781-85-3 | 2A-9040454 |
| Pirenzepine | 28797-61-7 | 2A-9040458 |
| Dichloro[2,2]paracyclophane | 28804-46-8 | 2A-9040459 |
| 3-Isobutyl-1-methylxanthine | 28822-58-4 | 2A-9040464 |
| Isobornyl 2-methyl-2-propenoate | 28854-39-9 | 2A-9040467 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA