
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 27327-48-6 |
| Catalog No. | 2A-9040171 |
| Chinese Name | 4-甲氧基苯胺-2,5-二磺酸 |
| Synonyms | 4-Methoxyaniline-2,5-disulfonic acid; MFCD00797926; p-anisidine-2,5-disulfonic acid |
| Molecular Formula | C7H9NO7S2 |
| Molecular Weight | 283.27900 |
| Purity | 98.00 |
| Density | 1.757 g/cm3 |
| HTC | 2922299090 |
| SMILES | COc1cc(S(=O)(=O)O)c(N)cc1S(=O)(=O)O |
| InChI Key | GLABVBIYGGDCNO-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Levobupivacaine hydrochloride | 27262-48-2 | 2A-9040156 |
| Polyalkyleneoxide modified heptamethyltrisiloxane | 27306-78-1 | 2A-9040164 |
| Ammonium-nitrido-octachlorodiaquodiruthenate(IV) | 27316-90-1 | 2A-9040168 |
| 1,10-Phenanthroline-5,6-dione | 27318-90-7 | 2A-9040169 |
| 2-(2-Pyridyl)ethyltrimethoxysilane | 27326-65-4 | 2A-9040170 |
| Diethyl benzhydrylphosphonate | 27329-60-8 | 2A-9040172 |
| 1,3,3-Trimethylindolinonaphthospirooxazine | 27333-47-7 | 2A-9040175 |
| Oxazoline | 27341-52-2 | 2A-9040178 |
| 1,3,5,7-Tetravinyl-1,3,5,7-tetramethylcyclotetrasiloxane | 27342-69-4 | 2A-9040179 |
| L-Lysine-L-aspartate | 27348-32-9 | 2A-9040181 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA