
CAS Number26549-65-5
Synonyms2,3-ISOPROPYLIDENE-D-THREITOL 1,4-DITOSYLATE; 2-O,3-O-Isopropylidene-D-threitol 1,4-ditosylate; (+)-N,N,N',N'-Tetramethyl-L-tartardiamide; (R,R)-(+)-2,3-Dihydroxy-N,N,N',N'-tetramethylsuccinamide; MFCD00025672; N,N,N',N'-tetramethyltartaric acid diamide; 1,4-DI-O-TOSYL-2,3-O-ISOPROPYLIDENE-D-THREITOL
Molecular FormulaC8H16N2O4
Molecular Weight204.22400
Purity98.00%
Density1.236 g/cm3
Boiling Point404.8ºC at 760 mmHg
Melting Point184-186ºC
Appearancewhite solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 26549-65-5 |
| Catalog No. | 2A-9039992 |
| Chinese Name | N,N,N',N'-四甲基-L-酒石酰胺 |
| Synonyms | 2,3-ISOPROPYLIDENE-D-THREITOL 1,4-DITOSYLATE; 2-O,3-O-Isopropylidene-D-threitol 1,4-ditosylate; (+)-N,N,N',N'-Tetramethyl-L-tartardiamide; (R,R)-(+)-2,3-Dihydroxy-N,N,N',N'-tetramethylsuccinamide; MFCD00025672; N,N,N',N'-tetramethyltartaric acid diamide; 1,4-DI-O-TOSYL-2,3-O-ISOPROPYLIDENE-D-THREITOL |
| Molecular Formula | C8H16N2O4 |
| Molecular Weight | 204.22400 |
| Purity | 98.00 |
| Density | 1.236 g/cm3 |
| Boiling Point | 404.8ºC at 760 mmHg |
| Melting Point | 184-186ºC |
| Appearance | white solid |
| Storage Condition | Place in a tight container and store in a cool, dr |
| SMILES | CN(C)C(=O)C(O)C(O)C(=O)N(C)C |
| InChI | InChI=1S/C8H16N2O4/c1-9(2)7(13)5(11)6(12)8(14)10(3)4/h5-6,11-12H,1-4H3/t5-,6+ |
| InChI Key | PCYDYHRBODKVEL-PHDIDXHHSA-N |
| MSDS | msds/39992_2_26549_65_5.pdf |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl 4-tert-butylbenzoate | 26537-19-9 | 2A-9039985 |
| Zeranol | 26538-44-3 | 2A-9039986 |
| Diisooctyl azelaate | 26544-17-2 | 2A-9039987 |
| Isodecyl diphenyl phosphite | 26544-23-0 | 2A-9039988 |
| Disodium methylenebisnaphthalenesulfonate | 26545-58-4 | 2A-9039991 |
| 1,3-Diaminoadamantane dihydrochloride | 26562-81-2 | 2A-9039994 |
| 2'-Chloro-6'-diethylaminofluoran | 26567-23-7 | 2A-9039995 |
| Alisol B acetate | 26575-95-1 | 2A-9039997 |
| 4-Methylaniline-2,5-disulphonic acid | 26585-57-9 | 2A-9040000 |
| Poly(acrylamide-co-diallyldimethylammonium chloride) | 26590-05-6 | 2A-9040001 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA