
CAS Number25711-72-2
SynonymsUrea,(3-aminophenyl); N-(3-aminophenyl)urea; 3-Aminophenylurea; Urea,N-(3-aminophenyl); m-aminophenyl urea; 1-(3-Aminophenyl)urea; 1-amino-3-ureidobenzene; 3-ureidoaniline; 3-ureidoaminoaniline; m-Ureidoaniline
Molecular FormulaC7H9N3O
Molecular Weight151.166
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point321.0±25.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 25711-72-2 |
| Catalog No. | 2A-9039791 |
| Chinese Name | N-(3-氨基苯基)脲 |
| Synonyms | Urea,(3-aminophenyl); N-(3-aminophenyl)urea; 3-Aminophenylurea; Urea,N-(3-aminophenyl); m-aminophenyl urea; 1-(3-Aminophenyl)urea; 1-amino-3-ureidobenzene; 3-ureidoaniline; 3-ureidoaminoaniline; m-Ureidoaniline |
| Molecular Formula | C7H9N3O |
| Molecular Weight | 151.166 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 321.0±25.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, protected from light, dry and sealed |
| HTC | 2924299090 |
| SMILES | NC(=O)Nc1cccc(N)c1 |
| InChI | InChI=1S/C7H9N3O/c8-5-2-1-3-6(4-5)10-7(9)11/h1-4H,8H2,(H3,9,10,11) |
| InChI Key | ZNXSFVXZQBETRJ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(N-Ethyl-N-2-hydroxyethyl)-2-methylphenylenediamine sulfate; CD-4 | 25646-77-9 | 2A-9039780 |
| 5-[1-Methyl-2-(3-methylthiazolidin-2-ylidene)ethylidene]-4-oxo-2-thioxothiazolidin-3-acetic acid | 25651-76-7 | 2A-9039781 |
| L-Alanosine | 5854-93-3 | 2A-9039782 |
| Poly(sodium-p-styrenesulfonate) | 25704-18-1 | 2A-9039789 |
| Vat Green 2 | 25704-81-8 | 2A-9039790 |
| 5-Cyano-1-indanone | 25724-79-2 | 2A-9039795 |
| 4-(Phenylethynyl)benzoic acid | 25739-23-5 | 2A-9039796 |
| 2-Chloro-5-nitrobenzoyl chloride | 25784-91-2 | 2A-9039803 |
| Propoxylated glycerin | 25791-96-2 | 2A-9039805 |
| 4H-Cyclopenta[2,1-b:3,4-b']dithiophen-4-one | 25796-77-4 | 2A-9039807 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA