
CAS Number1421-49-4
SynonymsEINECS 215-823-2; 3,5-Di-tert-butyl-4-hydroxybenzoic Acid; MFCD00008827; 3,5-ditert-butyl-4-hydroxybenzoic acid
Molecular Formula[(CH3)3C]2C6H2(OH)CO2H
Molecular Weight250.33
Purity98%
Density1.07 g/cm3
Boiling Point340.6ºC at 760 mmHg
Melting Point206-209 °C (lit.)
Appearancesolid
EINECS215-823-2
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1421-49-4 |
| Catalog No. | 2A-9003964 |
| Chinese Name | 3,5-二叔丁基-4-羟基苯甲酸 |
| Synonyms | EINECS 215-823-2; 3,5-Di-tert-butyl-4-hydroxybenzoic Acid; MFCD00008827; 3,5-ditert-butyl-4-hydroxybenzoic acid |
| Molecular Formula | [(CH3)3C]2C6H2(OH)CO2H |
| Molecular Weight | 250.33 |
| Purity | 98 |
| Density | 1.07 g/cm3 |
| Boiling Point | 340.6ºC at 760 mmHg |
| Melting Point | 206-209 °C (lit.) |
| Appearance | solid |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| EINECS | 215-823-2 |
| HTC | 2918290000 |
| PubChem ID | 24848587 |
| MDL Number | MFCD00008827 |
| SMILES | CC(C)(C)c1cc(cc(c1O)C(C)(C)C)C(O)=O |
| InChI | 1S/C15H22O3/c1-14(2,3)10-7-9(13(17)18)8-11(12(10)16)15(4,5)6/h7-8,16H,1-6H3,(H,17,18) |
| InChI Key | YEXOWHQZWLCHHD-UHFFFAOYSA-N |
| Beilstein/REAXYS | 2216948 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | Xn |
| Risk Codes | R22;R36/37/38 |
| Safety Description | S26;S36 |
| MSDS | msds/3964_1_1421_49_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards 3,5-di-tert-butyl-4-hydroxybenzoic acid Modification number: 2 Module 14. Shipping information UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-Dinitro-4-phenoxybenzoic acid | 35138-18-2 | 2A-9003956 |
| 3,5-Dinitroaniline | 618-87-1 | 2A-9003957 |
| 3,5-Dinitrobenzotrifluoride | 401-99-0 | 2A-9003958 |
| 3,5-Dinitrosalicyclic acid methy ester | 22633-33-6 | 2A-9003959 |
| 3,5-Diphenylcyclopentane-1,2,4-trione | 7003-69-2 | 2A-9003961 |
| 3,5-Di-tert-butyl-4-hydroxybenzoic acid hexadecyl ester | 67845-93-6 | 2A-9003965 |
| 3,5-Ditertbutylbenzoic acid | 16225-26-6 | 2A-9003966 |
| 3,5-Heptanedione | 7424-54-6 | 2A-9003967 |
| 3,6-Difluorophthalic acid | 651-97-8 | 2A-9003973 |
| 3,7,11,15-Tetramethyl-1,6,10,14-hexadecatetraen-3-ol | 1113-21-9 | 2A-9003975 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA