
CAS Number24801-88-5
Synonyms3-triethoxysilylpropyl isocyanate; 3-(triethoxysilyl)-propylisocyanate; Isocyanic Acid 3-(Triethoxysilyl)propyl Ester; i7840; 3-(triethoxysilyl)-propyl-isocyanate; yh9030; MFCD00051459; y9030; 3-isocyanatepropyltriethoxysilane; EINECS 246-467-6; 3-triethoxysilanylpropyl isocyanate; 3-(triethoxysilyl)-propyl isocyanate; 3-(Triethoxysilyl)propyl Isocyanate; 3-(triethoxysilyl)propylisocyanate
Molecular FormulaC10H21NO4Si
Molecular Weight247.363
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point263.0±13.0 °C at 760 mmHg
Melting Point<0ºC
AppearanceColorless to yellow liquid
EINECS246-467-6
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 24801-88-5 |
| Catalog No. | 2A-9039563 |
| Chinese Name | 异氰酸丙基三乙氧基硅烷 |
| Synonyms | 3-triethoxysilylpropyl isocyanate; 3-(triethoxysilyl)-propylisocyanate; Isocyanic Acid 3-(Triethoxysilyl)propyl Ester; i7840; 3-(triethoxysilyl)-propyl-isocyanate; yh9030; MFCD00051459; y9030; 3-isocyanatepropyltriethoxysilane; EINECS 246-467-6; 3-triethoxysilanylpropyl isocyanate; 3-(triethoxysilyl)-propyl isocyanate; 3-(Triethoxysilyl)propyl Isocyanate; 3-(triethoxysilyl)propylisocyanate |
| Molecular Formula | C10H21NO4Si |
| Molecular Weight | 247.363 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 263.0±13.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Appearance | Colorless to yellow liquid |
| Storage Condition | 2-8℃ |
| Packaging | III |
| EINECS | 246-467-6 |
| HTC | 2931900090 |
| UN(IATA) | UN 3390 |
| SMILES | CCO[Si](CCCN=C=O)(OCC)OCC |
| InChI | InChI=1S/C10H21NO4Si/c1-4-13-16(14-5-2,15-6-3)9-7-8-11-10-12/h4-9H2,1-3H3 |
| InChI Key | FRGPKMWIYVTFIQ-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| Risk Codes | R21/22;R26;R34;R42 |
| MSDS | msds/39563_2_24801_88_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Proper shipping name: Toxic Liquid, Corrosive, Organic, Not Otherwise Specified |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Item 1 Poisons. Sub-hazards: Category 8 Corrosives UN number: 2927 Proper shipping name: Toxic Liquid, Corrosive, Organic, Not Otherwise Specified Packing grade: II |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N,N'-(1,4-Phenylene)bis(acetoacetamide) | 24731-73-5 | 2A-9039555 |
| 5'-Methoxylaudanosine | 24734-71-2 | 2A-9039556 |
| 1-(4-Methoxy-1-naphthyl)ethanone | 24764-66-7 | 2A-9039557 |
| 1-Adamantylmalonic acid | 24779-68-8 | 2A-9039559 |
| Oxazine 1 perchlorate | 24796-94-9 | 2A-9039561 |
| Trihexyl O-acetylcitrate | 24817-92-3 | 2A-9039567 |
| 4-Diethylamino-2-methylphenylammonium chloride | 24828-38-4 | 2A-9039569 |
| Methyl dihydrojasmonate | 24851-98-7 | 2A-9039572 |
| Azaphen hydrochloride | 24853-80-3 | 2A-9039573 |
| Uracil-5-D | 24897-50-5 | 2A-9039578 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA