
CAS Number24502-78-1
Synonyms1'O-acetylshikonin; (1R)-1-(5,8-Dihydroxy-1,4-dioxo-1,4-dihydro-2-naphthalenyl)-4-methyl-3-penten-1-yl acetate; O-Acetylshikonin; Shikonin acetate; acethylshikonin; (1R)-1-(5,8-Dihydroxy-1,4-dioxo-1,4-dihydronaphthalen-2-yl)-4-methylpent-3-en-1-yl acetate; Acetylshikonin: 1,4-Naphthalenedione,2-[1-(acetyloxy)-4-methyl-3-pentenyl]-5,8-dihydroxy-, (R)-,; Shikonin,acetyl; MFCD00143538; acetyl shikonin; (R)-1-(5,8-dihydroxy-1,4-dioxo-1,4-dihydronaphthalen-2-yl)-4-methylpent-3-enyl acetate
Molecular FormulaC18H18O6
Molecular Weight330.332
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point553.2±50.0 °C at 760 mmHg
Melting Point86°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 24502-78-1 |
| Catalog No. | 2A-9039503 |
| Chinese Name | 乙酰紫草素 |
| Synonyms | 1'O-acetylshikonin; (1R)-1-(5,8-Dihydroxy-1,4-dioxo-1,4-dihydro-2-naphthalenyl)-4-methyl-3-penten-1-yl acetate; O-Acetylshikonin; Shikonin acetate; acethylshikonin; (1R)-1-(5,8-Dihydroxy-1,4-dioxo-1,4-dihydronaphthalen-2-yl)-4-methylpent-3-en-1-yl acetate; Acetylshikonin: 1,4-Naphthalenedione,2-[1-(acetyloxy)-4-methyl-3-pentenyl]-5,8-dihydroxy-, (R)-,; Shikonin,acetyl; MFCD00143538; acetyl shikonin; (R)-1-(5,8-dihydroxy-1,4-dioxo-1,4-dihydronaphthalen-2-yl)-4-methylpent-3-enyl acetate |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.332 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 553.2±50.0 °C at 760 mmHg |
| Melting Point | 86°C |
| Storage Condition | Room temperature, dry, sealed |
| Application | Acetylshikonin, derived from comfrey root, has anti-cancer and anti-inflammatory effects. Acetylshikonin is a non-selective cytochrome P450 inhibitor with IC50 values for inhibition of all P450 isof |
| SMILES | CC(=O)OC(CC=C(C)C)C1=CC(=O)c2c(O)ccc(O)c2C1=O |
| InChI | InChI=1S/C18H18O6/c1-9(2)4-7-15(24-10(3)19)11-8-14(22)16-12(20)5-6-13(21)17(16)18(11)23/h4-6,8,15,20-21H,7H2,1-3H3 |
| InChI Key | WNFXUXZJJKTDOZ-UAVYNJCWSA-N |
| Transport Info | Product name: Acetylshikonin |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,2-Dibromoethyl acetate | 24442-57-7 | 2A-9039493 |
| tert-Butyl 2-bromobutanoate | 24457-21-4 | 2A-9039494 |
| Lauryl chloroformate | 24460-74-0 | 2A-9039495 |
| 2-Ethylhexyl chloroformate | 24468-13-1 | 2A-9039498 |
| 3-Methoxy-2-methylbenzoyl chloride | 24487-91-0 | 2A-9039501 |
| 3-Bromo-4-ethoxybenzoic acid | 24507-29-7 | 2A-9039504 |
| 4-Acetylamino-2-(bis(2-hydroxyethyl)amino)anisole | 24530-67-4 | 2A-9039508 |
| Pyropheophorbide-alpha | 24533-72-0 | 2A-9039509 |
| 2,6-Diethyl-4-methylaniline | 24544-08-9 | 2A-9039511 |
| Color developing agent CD-3 | 24567-76-8 | 2A-9039514 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA