
CAS Number149082-03-1
Synonyms(3,5-Dimethyl-4-nitro-2-pyridinyl)methanol; 3,5-Dimethyl-2-hydroxymethyl-4-nitropyridine; 2-(Hydroxymethyl)-3,5-dimethyl-4-nitropyridine; (3,5-Dimethyl-4-nitro-2-pyridyl)-1-methanol; 3,5-Dimethyl-4-nitro-2-pyridinemethanol; (3,5-Dimethyl-4-nitropyridin-2-yl)methanol; MFCD03426035; 3,5-Dimethyl-4-nitropyridine-2-methanol
Molecular FormulaC8H10N2O3
Molecular Weight182.177
Purity98%
Density1.3±0.1 g/cm3
Boiling Point349.7±37.0 °C at 760 mmHg
Melting Point66-70 °C(lit.)
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 149082-03-1 |
| Catalog No. | 2A-9003943 |
| Chinese Name | 3,5-二甲基-4-硝基吡啶-2-甲醇 |
| Synonyms | (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol; 3,5-Dimethyl-2-hydroxymethyl-4-nitropyridine; 2-(Hydroxymethyl)-3,5-dimethyl-4-nitropyridine; (3,5-Dimethyl-4-nitro-2-pyridyl)-1-methanol; 3,5-Dimethyl-4-nitro-2-pyridinemethanol; (3,5-Dimethyl-4-nitropyridin-2-yl)methanol; MFCD03426035; 3,5-Dimethyl-4-nitropyridine-2-methanol |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.177 |
| Purity | 98 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 349.7±37.0 °C at 760 mmHg |
| Melting Point | 66-70 °C(lit.) |
| Storage Condition | Storage: Sealed, cool, ventilated and dry |
| Packaging | III |
| HTC | 2933399090 |
| SMILES | Cc1cnc(CO)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10N2O3/c1-5-3-9-7(4-11)6(2)8(5)10(12)13/h3,11H,4H2,1-2H3 |
| InChI Key | KBCDOXSSYLFMHH-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| Risk Codes | R36/37/38 |
| Safety Description | S26;S36 |
| MSDS | msds/3943_1_149082_03_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 3,5-Dichloro-4-fluoropyridine | 2A-103876 | 2A-9003876 |
| 3,5-Dichloro-4-hydroxypyridine | 17228-70-5 | 2A-9003879 |
| 3,5-Dimethyl-1H-pyrrole-2-carboxaldehyde | 2199-58-8 | 2A-9003940 |
| 3,5-Dimethyl-2-ethylpyrazine | 27043-05-6 | 2A-9003941 |
| 3,5-Dimethyl-2-hydroxymethyl-4-methoxypyridine | 86604-78-6 | 2A-9003942 |
| 3,5-Dimethyl-4'-(2-chloroethyl)-1H-pyrazole | 79379-05-8 | 2A-9003944 |
| 3,5-Dimethyl-4-isoxazolecarbaldehyde | 54593-26-9 | 2A-9003946 |
| 3,5-Dimethylisooxazole | 300-87-8 | 2A-9003949 |
| 3,5-Dimethylisoxazole-4-sulphonyl chloride | 80466-79-1 | 2A-9003951 |
| 3,5-Dimethylpyrazole-1-carboxamide | 934-48-5 | 2A-9003954 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA