
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 135306-45-5 |
| Catalog No. | 2A-9003926 |
| Chinese Name | 3,5-二氟苯丙酮 |
| Synonyms | 1-(3,5-difluorophenyl)propan-1-one; 3',5'-Difluoropropiophenone; MFCD00061142; 3′,5′-Difluoropropiophenone |
| Molecular Formula | C9H8F2O |
| Molecular Weight | 170.15600 |
| Purity | 98 |
| Density | 1.166 g/cm3 |
| Boiling Point | 82°C 10mm |
| Melting Point | 25 °C |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| HTC | 2914700090 |
| SMILES | CCC(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C9H8F2O/c1-2-9(12)6-3-7(10)5-8(11)4-6/h3-5H,2H2,1H3 |
| InChI Key | FVDQWXARVQADKN-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-Difluorophenol | 2713-34-0 | 2A-9003920 |
| 3,5-Difluorophenylacetic acid | 105184-38-1 | 2A-9003921 |
| 3,5-Difluorophenylacetonitrile | 122376-76-5 | 2A-9003922 |
| 3,5-Difluorophenylhydrazine | 134993-88-7 | 2A-9003924 |
| 3,5-Difluorophenylhydrazine hydrochloride | 502496-27-7 | 2A-9003925 |
| 3,5-Dihydroxy-4-methylbenzoic acid | 28026-96-2 | 2A-9003927 |
| 3',5'-Dihydroxyacetophenone | 51863-60-6 | 2A-9003928 |
| 3,5-Dihydroxybenzyl alcohol | 29654-55-5 | 2A-9003930 |
| 3,5-Dimethoxy-4-hydroxybenzoic acid | 530-57-4 | 2A-9003933 |
| 3',5'-Dimethoxyacetophenone | 39151-19-4 | 2A-9003934 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA