
CAS Number23316-67-8
Synonyms(2R,3R,4S,5S)-2-(benzoyloxymethyl)-5-cyanotetrahydrofuran-3,4-diyl dibenzoate; 2,5-ANHYDRO-3,4,6-TRI-O-BENZOYL-D-ALLONONITRILE; 2,3,5-Tri-O-benzoyl-beta-D-ribofuranosyl cyanide; 2,3-DIFLUORO-6-METHOXYPHENYLACETIC ACID; 2,5-Anhydro-3,4,6-tri-O-benzoyl-D-allononitrile; 2,3,5-Tri-O-benzoyl-b-D-ribofuranosyl cyanide
Molecular FormulaC26H22O8
Molecular Weight462.46
Purity98.00%
Density1.35 g/cm3
Boiling Point643.1ºC at 760 mmHg
Melting Point65-75 °C
Appearancelight brown to brown solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 23316-67-8 |
| Catalog No. | 2A-9039233 |
| Chinese Name | 1-氰基-2,3,5-三苯甲酰氧基-beta-D-呋喃核糖 |
| Synonyms | (2R,3R,4S,5S)-2-(benzoyloxymethyl)-5-cyanotetrahydrofuran-3,4-diyl dibenzoate; 2,5-ANHYDRO-3,4,6-TRI-O-BENZOYL-D-ALLONONITRILE; 2,3,5-Tri-O-benzoyl-beta-D-ribofuranosyl cyanide; 2,3-DIFLUORO-6-METHOXYPHENYLACETIC ACID; 2,5-Anhydro-3,4,6-tri-O-benzoyl-D-allononitrile; 2,3,5-Tri-O-benzoyl-b-D-ribofuranosyl cyanide |
| Molecular Formula | C26H22O8 |
| Molecular Weight | 462.46 |
| Purity | 98.00 |
| Density | 1.35 g/cm3 |
| Boiling Point | 643.1ºC at 760 mmHg |
| Melting Point | 65-75 °C |
| Appearance | light brown to brown solid |
| Storage Condition | -20°C, inert gas |
| HTC | 2932190090 |
| MDL Number | MFCD02685276 |
| SMILES | N#CC1OC(COC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H21NO7/c28-16-21-23(34-26(30)19-12-6-2-7-13-19)24(35-27(31)20-14-8-3-9-15-20)22(33-21)17-32-25(29)18-10-4-1-5-11-18/h1-15,21-24H,17H2 |
| InChI Key | OFMYTVNDIRTGMR-UARRHKHWSA-N |
| MSDS | msds/39233_1_23316_67_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2,5-Dibromopyrazine | 23229-26-7 | 2A-9039211 |
| 5-Ethylthiophene-2-carboxylic acid | 23229-72-3 | 2A-9039212 |
| 6-Hydroxyindazole | 23244-88-4 | 2A-9039221 |
| Sulfachloropyridazine sodium | 23282-55-5 | 2A-9039227 |
| Ethyl 5-amino-3-methyl-1H-pyrazole-4-carboxylate | 23286-70-6 | 2A-9039228 |
| 1,2:5,6-Di-O-cyclohexylidene-alpha-D-glucofuranose | 23397-76-4 | 2A-9039246 |
| 6-Methoxy-4-hydroxyquinoline | 23432-39-5 | 2A-9039253 |
| 4-Hydroxy-6-nitroquinoline | 23432-42-0 | 2A-9039254 |
| 6-Chloro-4-hydroxyquinoline | 23432-43-1 | 2A-9039255 |
| 6-Hydroxy-5H-pyrrolo[3,4-b]pyridine-5,7(6H)-dione | 23439-87-4 | 2A-9039256 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA