
CAS Number23228-45-7
Synonyms2-chloro-4-trifluoromethyl-benzoic acid; 2-chloro-4-(trifluoromethyl)-benzoate; 4-Carboxy-3-chlorobenzotrifluoride; 2-Chloro-α,α,α-trifluoro-p-toluic acid; 2-Chloro-4-(trifluoromethyl)benzoic acid; QVR BG DXFFF
Molecular FormulaC8H4ClF3O2
Molecular Weight224.564
Purity98.00%
Density1.5±0.1 g/cm3
Boiling Point255.0±40.0 °C at 760 mmHg
Melting Point114-117℃
AppearanceWhite to yellow solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 23228-45-7 |
| Catalog No. | 2A-9039209 |
| Chinese Name | 2-氯-4-三氟甲基苯甲酸 |
| Synonyms | 2-chloro-4-trifluoromethyl-benzoic acid; 2-chloro-4-(trifluoromethyl)-benzoate; 4-Carboxy-3-chlorobenzotrifluoride; 2-Chloro-α,α,α-trifluoro-p-toluic acid; 2-Chloro-4-(trifluoromethyl)benzoic acid; QVR BG DXFFF |
| Molecular Formula | C8H4ClF3O2 |
| Molecular Weight | 224.564 |
| Purity | 98.00 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 255.0±40.0 °C at 760 mmHg |
| Melting Point | 114-117℃ |
| Appearance | White to yellow solid |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2916399090 |
| SMILES | O=C(O)c1ccc(C(F)(F)F)cc1Cl |
| InChI Key | DTIJZEUKFYGSEC-UHFFFAOYSA-N |
| MSDS | msds/39209_1_23228_45_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Ethylbenzaldehyde | 22927-13-5 | 2A-9039112 |
| Methyltris(methylethylketoxime)silane | 22984-54-9 | 2A-9039129 |
| 4-Methoxy-2-nitrobenzaldehyde | 22996-21-0 | 2A-9039134 |
| 2,6-Dimethoxyphenylboronic acid | 23112-96-1 | 2A-9039176 |
| 1,4-Dioxaspiro[4.4]nonane-6-methanol | 23153-74-4 | 2A-9039194 |
| 2-Methylthioacetaldehyde | 23328-62-3 | 2A-0202154 |
| 3-Iodosalicylaldehyde | 23602-64-4 | 2A-9039290 |
| 17-Ethinyl-17-hydroxy-18-methylestra-5(10),9(11)-dien-3-one-3-ethylene ketal | 23637-79-8 | 2A-9039301 |
| 3-Oxocyclobutanecarboxylic acid | 23761-23-1 | 2A-9039337 |
| 2-Chloromethyl-6-methylpyrimidin-4-ol | 23862-02-4 | 2A-9039361 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA