CAS Number132741-31-2
Synonyms2-(3,5-difluorophenyl)-2-hydroxyacetic acid; (2R)-(3,5-Difluorophenyl)(hydroxy)acetate; (3,5-Difluorophenyl)(hydroxy)acetic acid; 3,5-Difluoromandelic acid; MFCD00061300; 3,5-Difluoro mandelic acid
Molecular FormulaC8H5F2O3
Molecular Weight188.128
Purity97%
Density1.5±0.1 g/cm3
Boiling Point306.5±37.0 °C at 760 mmHg
Melting Point135-139 °C(lit.)
AppearanceSimilar to white solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 132741-31-2 |
| Catalog No. | 2A-9003918 |
| Chinese Name | 3,5-二氟扁桃酸 |
| Synonyms | 2-(3,5-difluorophenyl)-2-hydroxyacetic acid; (2R)-(3,5-Difluorophenyl)(hydroxy)acetate; (3,5-Difluorophenyl)(hydroxy)acetic acid; 3,5-Difluoromandelic acid; MFCD00061300; 3,5-Difluoro mandelic acid |
| Molecular Formula | C8H5F2O3 |
| Molecular Weight | 188.128 |
| Purity | 97 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 306.5±37.0 °C at 760 mmHg |
| Melting Point | 135-139 °C(lit.) |
| Appearance | Similar to white solid |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| HTC | 2918199090 |
| SMILES | O=C(O)C(O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C8H6F2O3/c9-5-1-4(2-6(10)3-5)7(11)8(12)13/h1-3,7,11H,(H,12,13)/p-1/t7-/m0/s1 |
| InChI Key | PHMLPPFFMSRWBK-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-Difluorobenzyl chloride | 220141-71-9 | 2A-9003912 |
| 3,5-Difluorobenzylbromide | 141776-91-2 | 2A-9003913 |
| 3,5-Difluorobromobenzene | 461-96-1 | 2A-9003914 |
| 3,5-Difluorochlorobenzene | 1435-43-4 | 2A-9003915 |
| 3,5-Difluoroiodobenzene | 2265-91-0 | 2A-9003917 |
| 3,5-Difluoronitrobenzene | 2265-94-3 | 2A-9003919 |
| 3,5-Difluorophenol | 2713-34-0 | 2A-9003920 |
| 3,5-Difluorophenylacetic acid | 105184-38-1 | 2A-9003921 |
| 3,5-Difluorophenylacetonitrile | 122376-76-5 | 2A-9003922 |
| 3,5-Difluorophenylhydrazine | 134993-88-7 | 2A-9003924 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS