
CAS Number79538-20-8
Synonyms3,5-Difluorobenzyl alcohol; MFCD00010313; 3,5-Difluorobenzenemethanol; (3,5-Difluorophenyl)methanol; Q1R CF EF
Molecular FormulaC7H6F2O
Molecular Weight144.119
Purity98%
Density1.3±0.1 g/cm3
Boiling Point182.0±25.0 °C at 760 mmHg
AppearanceTransparent colorless to very slightly brown liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 79538-20-8 |
| Catalog No. | 2A-9003911 |
| Chinese Name | 3,5-二氟苄醇 |
| Synonyms | 3,5-Difluorobenzyl alcohol; MFCD00010313; 3,5-Difluorobenzenemethanol; (3,5-Difluorophenyl)methanol; Q1R CF EF |
| Molecular Formula | C7H6F2O |
| Molecular Weight | 144.119 |
| Purity | 98 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 182.0±25.0 °C at 760 mmHg |
| Appearance | Transparent colorless to very slightly brown liquid |
| Storage Condition | Store in a sealed container in a cool, dry place. |
| SMILES | OCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C7H6F2O/c8-6-1-5(4-10)2-7(9)3-6/h1-3,10H,4H2 |
| InChI Key | LOGIHEKXJKHXEC-UHFFFAOYSA-N |
| Hazard Symbols | Xi |
| Risk Codes | R36/37/38 |
| Safety Description | S26;S37/39 |
| MSDS | msds/3911_1_79538_20_8.pdf |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-Difluorobenzenesulphonamide | 140480-89-3 | 2A-9003906 |
| 3,5-Difluorobenzenesulphonyl chloride | 210532-25-5 | 2A-9003907 |
| 3,5-Difluorobenzoic acid | 455-40-3 | 2A-9003908 |
| 3,5-Difluorobenzonitrile | 64248-63-1 | 2A-9003909 |
| 3,5-Difluorobenzoyl chloride | 129714-97-2 | 2A-9003910 |
| 3,5-Difluorobenzyl chloride | 220141-71-9 | 2A-9003912 |
| 3,5-Difluorobenzylbromide | 141776-91-2 | 2A-9003913 |
| 3,5-Difluorobromobenzene | 461-96-1 | 2A-9003914 |
| 3,5-Difluorochlorobenzene | 1435-43-4 | 2A-9003915 |
| 3,5-Difluoroiodobenzene | 2265-91-0 | 2A-9003917 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA