
CAS Number23233-88-7
SynonymsBrotianida [INN-Spanish]; 2-acetoxy-3-bromo-5-chloro-N-(4'-bromophenyl)-thionobenzamide; 2-Brom-6-(4-bromphenylthiocarbamoyl)-4-chlorphenylacetat; BAY-VA 4059; 3,4'-Dibromo-5-chlorothiosalicylanilide acetate (ester); Brotianide; Brotianidum [INN-Latin]; EINECS 245-505-9; Dirian; 2-Acetoxy-3-bromo-5-chloro-N-(p-bromophenyl)-thiobenzamide; FB a 4059
Molecular FormulaC15H10Br2ClNO2S
Molecular Weight463.58
Purity98.00%
Density1.795g/cm3
Boiling Point514.1ºC at 760mmHg
Melting Point181°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 23233-88-7 |
| Catalog No. | 2A-9039050 |
| Chinese Name | 溴替尼持 |
| Synonyms | Brotianida [INN-Spanish]; 2-acetoxy-3-bromo-5-chloro-N-(4'-bromophenyl)-thionobenzamide; 2-Brom-6-(4-bromphenylthiocarbamoyl)-4-chlorphenylacetat; BAY-VA 4059; 3,4'-Dibromo-5-chlorothiosalicylanilide acetate (ester); Brotianide; Brotianidum [INN-Latin]; EINECS 245-505-9; Dirian; 2-Acetoxy-3-bromo-5-chloro-N-(p-bromophenyl)-thiobenzamide; FB a 4059 |
| Molecular Formula | C15H10Br2ClNO2S |
| Molecular Weight | 463.58 |
| Purity | 98.00 |
| Density | 1.795g/cm3 |
| Boiling Point | 514.1ºC at 760mmHg |
| Melting Point | 181°C |
| Storage Condition | The warehouse is ventilated and dried at low tempe |
| HTC | 2930909090 |
| MDL Number | C15H10Br2ClNO2S |
| SMILES | CC(=O)Oc1c(Br)cc(Cl)cc1C(=S)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H10Br2ClNO2S/c1-8(20)21-14-12(6-10(18)7-13(14)17)15(22)19-11-4-2-9(16)3-5-11/h2-7H,1H3,(H,19,22) |
| InChI Key | NRFGEDASJHBPPN-UHFFFAOYSA-N |
| MSDS | msds/39050_1_23233_88_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2930909090. other organo-sulfur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-[3-[(2-Cyanoethyl)(2-hydroxyethyl)amino]-4-methoxyphenyl]acetamide | 22588-78-9 | 2A-9039035 |
| 4-(Thiomorpholin-4-yl)aniline | 22589-35-1 | 2A-9039036 |
| 1,1-Dichloro-3,3-dimethylbutan-2-one | 22591-21-5 | 2A-9039037 |
| 6-tert-Butyl-4-methyl-2-[(4-chloro-2-nitrophenyl)azo]phenol | 22617-04-5 | 2A-9039042 |
| Methylguanidine hydrochloride | 22661-87-6 | 2A-9039049 |
| 4-Chlorobenzenesulfonyl urea | 22663-37-2 | 2A-9039051 |
| Sodium bis(2-methoxyethoxy)aluminiumhydride | 22722-98-1 | 2A-9039061 |
| 3-Bromobenzamide | 22726-00-7 | 2A-9039062 |
| 4,4-Dimethyl-2-cyclopenten-1-one | 22748-16-9 | 2A-9039064 |
| 6-Chlorobenzo[c][1,2]benzoxaphosphinine | 22749-43-5 | 2A-9039065 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA