
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 132980-99-5 |
| Catalog No. | 2A-9003905 |
| Chinese Name | 3,5-二氟苯甲酰胺 |
| Synonyms | 3,5-Difluorobenzamide; Benzamide,3,5-difluoro; MFCD00061138 |
| Molecular Formula | C7H5F2NO |
| Molecular Weight | 157.11800 |
| Purity | 97 |
| Density | 1.348g/cm3 |
| Boiling Point | 187.7ºC at 760mmHg |
| Melting Point | 155-159 °C(lit.) |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| HTC | 2924299090 |
| SMILES | NC(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C7H5F2NO/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H2,10,11) |
| InChI Key | CGOIBYYWOVRGGV-UHFFFAOYSA-N |
| MSDS | msds/3905_1_132980_99_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-Dichlorothioanisole | 68121-46-0 | 2A-9003898 |
| 3',5'-Difluoro-4'-hydroxypropiophenone | 178374-78-2 | 2A-9003900 |
| 3',5'-Difluoroacetophenone | 123577-99-1 | 2A-9003901 |
| 3,5-Difluoroaniline | 372-39-4 | 2A-9003902 |
| 3,5-Difluoroanisole | 93343-10-3 | 2A-9003903 |
| 3,5-Difluorobenzenesulphonamide | 140480-89-3 | 2A-9003906 |
| 3,5-Difluorobenzenesulphonyl chloride | 210532-25-5 | 2A-9003907 |
| 3,5-Difluorobenzoic acid | 455-40-3 | 2A-9003908 |
| 3,5-Difluorobenzonitrile | 64248-63-1 | 2A-9003909 |
| 3,5-Difluorobenzoyl chloride | 129714-97-2 | 2A-9003910 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA