
CAS Number22286-82-4
Synonymsethyl 2-phenylprop-2-enoate; Benzeneacetic acid, α-methylene-, ethyl ester; Ethyl atropate; EthylAtropate
Molecular FormulaC11H12O2
Molecular Weight176.22
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point272.9±19.0 °C at 760 mmHg
AppearanceColorless to yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 22286-82-4 |
| Catalog No. | 2A-9038946 |
| Chinese Name | 2-苯基丙烯酸乙酯 |
| Synonyms | ethyl 2-phenylprop-2-enoate; Benzeneacetic acid, α-methylene-, ethyl ester; Ethyl atropate; EthylAtropate |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 272.9±19.0 °C at 760 mmHg |
| Appearance | Colorless to yellow liquid |
| Storage Condition | 2-8°C, inert gas |
| HTC | 2916399090 |
| MDL Number | MFCD00026862 |
| SMILES | C=C(C(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C11H12O2/c1-3-13-11(12)9(2)10-7-5-4-6-8-10/h4-8H,2-3H2,1H3 |
| InChI Key | BOIWYTYYWPXGAT-UHFFFAOYSA-N |
| MSDS | msds/38946_1_22286_82_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4'-(Difluoromethoxy)acetanilide | 22236-11-9 | 2A-9038921 |
| 7-Amino-3,4-dihydro-1H-quinolin-2-one | 22246-07-7 | 2A-9038925 |
| 8-Methoxy-2,3,4,5-tetrahydrobenzo[c]azepin-1-one | 22246-71-5 | 2A-9038927 |
| 2,2-DIFLUOROACETYL CHLORIDE | 381-72-6 | 2A-9038931 |
| Bromocriptine mesylate | 22260-51-1 | 2A-9038932 |
| 4,4'-Bis(4-chlorophenyl)sulfonyl-1,1'-biphenyl | 22287-56-5 | 2A-9038947 |
| 2-Amino-N-(3-chlorophenyl)benzamide | 22312-61-4 | 2A-9038951 |
| (+/-)-Cryptostyline III | 22324-83-0 | 2A-9038954 |
| 5-Sulfoisophthalic acid | 22326-31-4 | 2A-9038956 |
| Dibenzoyltartaric acid | 22333-70-6 | 2A-9038959 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA