
CAS Number1435-46-7
Synonyms3,5-Dichlorofluorobenzene; 1,3-Dichloro-5-fluorobenzene; MFCD00060652
Molecular FormulaC6H3Cl2F
Molecular Weight164.992
Purity99%
Density1.4±0.1 g/cm3
Boiling Point164.7±20.0 °C at 760 mmHg
AppearanceColorless to light yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1435-46-7 |
| Catalog No. | 2A-9003893 |
| Chinese Name | 3,5-二氯氟苯 |
| Synonyms | 3,5-Dichlorofluorobenzene; 1,3-Dichloro-5-fluorobenzene; MFCD00060652 |
| Molecular Formula | C6H3Cl2F |
| Molecular Weight | 164.992 |
| Purity | 99 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 164.7±20.0 °C at 760 mmHg |
| Appearance | Colorless to light yellow liquid |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| Packaging | III |
| HTC | 2903999090 |
| SMILES | Fc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C6H3Cl2F/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| InChI Key | BLWGKIXZAUOECS-UHFFFAOYSA-N |
| Hazard Symbols | Category 3 |
| MSDS | msds/3893_1_1435_46_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations Classification: Class 3 Flammable Liquids. UN number: 1993 Proper shipping name: Flammable Liquid, not otherwise specified Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-Dichlorobenzenesulphonyl chloride | 705-21-5 | 2A-9003888 |
| 3,5-Dichlorobenzoic acid | 51-36-5 | 2A-9003889 |
| 3,5-Dichlorobenzonitrile | 6575-00-4 | 2A-9003890 |
| 3,5-Dichlorobenzoyl chloride | 2905-62-6 | 2A-9003891 |
| 3,5-Dichlorobenzylamine | 39989-43-0 | 2A-9003892 |
| 3,5-Dichloroisonicotinic acid | 13958-93-5 | 2A-9003894 |
| 3,5-Dichloronitrobenzene | 618-62-2 | 2A-9003895 |
| 3,5-Dichlorophenylhydrazine hydrochloride | 63352-99-8 | 2A-9003896 |
| 3,5-Dichlorothioanisole | 68121-46-0 | 2A-9003898 |
| 3',5'-Difluoro-4'-hydroxypropiophenone | 178374-78-2 | 2A-9003900 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA