
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5980-23-4 |
| Catalog No. | 2A-9003886 |
| Chinese Name | 3,5-二氯苯甲酰胺 |
| Synonyms | MFCD00057644; 3,5-Dichlor-benzamid; 3,5-dichloro-benzamide; 3,5-bis(chloranyl)benzamide; Benzamide,3,5-dichloro |
| Molecular Formula | C7H5Cl2NO |
| Molecular Weight | 190.02700 |
| Purity | 99 |
| Density | 1.439g/cm3 |
| Boiling Point | 264.2ºC at 760 mmHg |
| Melting Point | 160 °C |
| Storage Condition | Keep away from light, cool and dry place, sealed a |
| HTC | 2924299090 |
| SMILES | NC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C7H5Cl2NO/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H2,10,11) |
| InChI Key | DELNZTRPJTUOIP-UHFFFAOYSA-N |
| MSDS | msds/3886_1_5980_23_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-Dichloro-4-hydroxybenzoic acid methyl ester | 3337-59-5 | 2A-9003878 |
| 3,5-Dichloro-4-iodobenzotrifluoride | 175205-56-8 | 2A-9003880 |
| 3,5-Dichloro-4-methoxybenzoic acid | 41727-58-6 | 2A-9003881 |
| 3,5-Dichloroaniline | 626-43-7 | 2A-9003882 |
| 3,5-Dichloroanthranilic acid | 2789-92-6 | 2A-9003883 |
| 3,5-Dichlorobenzenesulphonamide | 19797-32-1 | 2A-9003887 |
| 3,5-Dichlorobenzenesulphonyl chloride | 705-21-5 | 2A-9003888 |
| 3,5-Dichlorobenzoic acid | 51-36-5 | 2A-9003889 |
| 3,5-Dichlorobenzonitrile | 6575-00-4 | 2A-9003890 |
| 3,5-Dichlorobenzoyl chloride | 2905-62-6 | 2A-9003891 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA