CAS Number22027-50-5
Synonyms3-(4-Methoxyphenyl)-3-oxo-propionic acid methylester; Methyl 3-(4-methoxyphenyl)-3-oxopropanoate; Methyl 3-(4-methoxyphenyl)-3-oxo-propionate; EINECS 244-732-0; Benzenepropanoic acid, 4-methoxy-β-oxo-, methyl ester; Methyl 4-methoxybenzoylacetate; MFCD01082033; 3-(4-Methoxyphenyl)-3-oxo-propionicacidmethylester; methyl p-methoxybenzoylacetate
Molecular FormulaC11H12O4
Molecular Weight208.211
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point315.4±17.0 °C at 760 mmHg
Melting Point40-42ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 22027-50-5 |
| Catalog No. | 2A-9038854 |
| Chinese Name | 3-(4-甲氧基苯基)-3-氧代丙酸甲酯 |
| Synonyms | 3-(4-Methoxyphenyl)-3-oxo-propionic acid methylester; Methyl 3-(4-methoxyphenyl)-3-oxopropanoate; Methyl 3-(4-methoxyphenyl)-3-oxo-propionate; EINECS 244-732-0; Benzenepropanoic acid, 4-methoxy-β-oxo-, methyl ester; Methyl 4-methoxybenzoylacetate; MFCD01082033; 3-(4-Methoxyphenyl)-3-oxo-propionicacidmethylester; methyl p-methoxybenzoylacetate |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.211 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 315.4±17.0 °C at 760 mmHg |
| Melting Point | 40-42ºC |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| SMILES | COC(=O)CC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C11H12O4/c1-14-9-5-3-8(4-6-9)7-10(12)11(13)15-2/h3-6H,7H2,1-2H3 |
| InChI Key | VXXOASOINNOPGR-UHFFFAOYSA-N |
| MSDS | msds/38854_1_22027_50_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Methylpropanimidamide hydrochloride | 22007-68-7 | 2A-9038849 |
| 7-Methyl-1-tetralone | 22009-37-6 | 2A-9038850 |
| 7-Hydroxy-1-tetralone | 22009-38-7 | 2A-9038851 |
| 1,4-Benzodioxan-6-amine | 22013-33-8 | 2A-9038852 |
| 5-Nitro-2-pentanone | 22020-87-7 | 2A-9038853 |
| 2-[N-(2-Cyanoethyl)anilino]ethyl acetate | 22031-33-0 | 2A-9038856 |
| Cartap | 22042-59-7 | 2A-9038864 |
| 4-Formylphenoxyacetic acid | 22042-71-3 | 2A-9038865 |
| Diethylenetriaminepenta(methylenephosphonicacid) sodium salt | 22042-96-2 | 2A-9038867 |
| N-Hydroxyacetamidine | 22059-22-9 | 2A-9038870 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS