![2-Methylimidazo[1,2-a]pyridine-3-carboxylic acid structure, CAS 21801-79-6](/structures/40000/38782_1_21801_79_6.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 21801-79-6 |
| Catalog No. | 2A-9038782 |
| Chinese Name | 2-甲基咪唑并吡啶-3-羧酸 |
| Synonyms | 2-Methylimidazo[1,2-a]pyridine-3-carboxylic acid; MFCD00244615 |
| Molecular Formula | C9H8O2N2 |
| Molecular Weight | 176.17 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 170ºC |
| Melting Point | 140ºC |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933990090 |
| MDL Number | MFCD00244615 |
| SMILES | Cc1nc2ccccn2c1C(=O)O |
| InChI | InChI=1S/C9H8N2O2/c1-6-8(9(12)13)11-5-3-2-4-7(11)10-6/h2-5H,1H3,(H,12,13) |
| InChI Key | FBIUGCLQMKPURJ-UHFFFAOYSA-N |
| MSDS | msds/38782_1_21801_79_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| 6-Bromo-3H-oxazolo[4,5-b]pyridin-2-one | 21594-52-5 | 2A-9038714 |
| 11-Piperazinyldibenz[b,f][1,4]oxazepine | 21636-40-8 | 2A-9038731 |
| (S)-(-)-2-Hydroxy-3,3-dimethylbutyric acid | 21641-92-9 | 2A-9038734 |
| N-Cbz-DL-norvaline | 21691-44-1 | 2A-9038760 |
| Imidazo[1,2-a]pyridine-2-acetic acid ethyl ester | 21755-34-0 | 2A-9038777 |
| (S)-2-Aminotetralin | 21880-87-5 | 2A-9038797 |
| (S)-N-Cbz-Phenylalaninenitrile | 21947-21-7 | 2A-9038835 |
| (R)-1,2,3,4-Tetrahydro-2-naphthylamine | 21966-60-9 | 2A-9038843 |
| (R)-(-)-alpha-(Trifluoromethyl)benzylamine | 22038-85-3 | 2A-9038860 |
| (R)-(+)-1-(4-Methoxyphenyl)ethylamine | 22038-86-4 | 2A-9038861 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA