
CAS Number21239-29-2
SynonymsMFCD00015440; 3,5-dimethyl-benzoic acid ethyl ester; EINECS 244-286-7; 3,5-Dimethyl-ethylbenzoat; 3,5-Dimethylbenzoesaeure-ethylester; 3,5-Dimethyl-benzoesaeure-aethylester
Molecular FormulaC11H14O2
Molecular Weight178.23
Purity98.00%
Density1.113
Boiling Point120ºC 10mm
Appearancecolorless liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 21239-29-2 |
| Catalog No. | 2A-9038638 |
| Chinese Name | 3,5-二甲基苯甲酸乙酯 |
| Synonyms | MFCD00015440; 3,5-dimethyl-benzoic acid ethyl ester; EINECS 244-286-7; 3,5-Dimethyl-ethylbenzoat; 3,5-Dimethylbenzoesaeure-ethylester; 3,5-Dimethyl-benzoesaeure-aethylester |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 |
| Purity | 98.00 |
| Density | 1.113 |
| Boiling Point | 120ºC 10mm |
| Appearance | colorless liquid |
| Storage Condition | Place in a tight container and store in a cool, dr |
| HTC | 2916399090 |
| MDL Number | MFCD00015440 |
| SMILES | CCOC(=O)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C11H14O2/c1-4-13-11(12)10-6-8(2)5-9(3)7-10/h5-7H,4H2,1-3H3 |
| InChI Key | IHAAVLXHNOZMBC-UHFFFAOYSA-N |
| MSDS | msds/38638_1_21239_29_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Nitroisophthalic acid | 21161-11-5 | 2A-9038620 |
| 3,20-Dioxopregn-4-en-21-yl 4-bromobenzenesulfonate | 21170-34-3 | 2A-9038623 |
| D-Galactal | 21193-75-9 | 2A-9038629 |
| Dorastine | 21228-13-7 | 2A-9038636 |
| 6-Amino-3-methyluracil | 21236-97-5 | 2A-9038637 |
| 4,5-Diphenyl-1,3-dioxol-2-one | 21240-34-6 | 2A-9038639 |
| Padimate | 21245-01-2 | 2A-9038641 |
| 7-Hydroxy-2,3-dihydro-1H-cyclopenta[c]chromen-4-one | 21260-41-3 | 2A-9038645 |
| 3-Oxo-butyric acid 2-(2-methylacryloyloxy)ethyl ester | 21282-97-3 | 2A-9038649 |
| Cyclopropanesulfonic acid | 21297-68-7 | 2A-9038654 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA