
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 175205-85-3 |
| Catalog No. | 2A-9003863 |
| Chinese Name | 3,5-二溴苯甲酰胺 |
| Synonyms | 3,5-dibromobenzamide |
| Molecular Formula | C7H5Br2NO |
| Molecular Weight | 278.92900 |
| Purity | 97 |
| Density | 1.985g/cm3 |
| Boiling Point | 304.7ºC at 760mmHg |
| Melting Point | 187-190ºC |
| Storage Condition | Storage: Sealed, cool, ventilated and dry |
| HTC | 2924299090 |
| UN(IATA) | UN2811 6.1/PG 3 |
| SMILES | NC(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C7H5Br2NO/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H2,10,11) |
| InChI Key | IOFGMNBDIDEBIQ-UHFFFAOYSA-N |
| Hazard Symbols | Xn |
| Risk Codes | R22 |
| MSDS | msds/3863_1_175205_85_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3',5'-Diacetoxyacetophenone | 35086-59-0 | 2A-9003851 |
| 3,5-Diaminobenzotrifluoride | 368-53-6 | 2A-9003852 |
| 3,5-Dibenzyloxybenzyl alcohol | 24131-31-5 | 2A-9003853 |
| 3,5-Dibromo-2-methoxybenzoic acid | 13130-23-9 | 2A-9003858 |
| 3,5-Dibromo-4-methylbenzoic acid | 67973-32-4 | 2A-9003862 |
| 3,5-Dibromobenzoic acid | 618-58-6 | 2A-9003864 |
| 3',5'-Dichloro-2'-fluoroacetophenone | 480438-93-5 | 2A-9003870 |
| 3',5'-Dichloro-2'-hydroxyacetophenone | 3321-92-4 | 2A-9003871 |
| 3,5-Dichloro-4-aminobenzoic acid | 56961-25-2 | 2A-9003873 |
| 3,5-Dichloro-4-fluorobenzotrifluoride | 77227-81-7 | 2A-9003874 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA