
CAS Number21059-46-1
SynonymsL-Aspartic acid, calcium salt (1:1); Aspara-CA; Elspri-CA; calciumsalt,l-asparticaci; Calcium (2S)-2-aminosuccinate; EINECS 244-185-8; CalciumL-aspartate; Calcium L-aspartic acid; calciretard; asparaginatecalcium; Di-L-Aspartate; Astos-CA; MFCD00045869; Aspartic acid (calcium)
Molecular FormulaC4H5CaNO4
Molecular Weight171.165
Purity98.00%
Density1.514g/cm3
Boiling Point264.1ºC at 760 mmHg
Melting Point270-271ºC
Appearancewhite powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 21059-46-1 |
| Catalog No. | 2A-9038600 |
| Chinese Name | L-天冬氨酸钙 |
| Synonyms | L-Aspartic acid, calcium salt (1:1); Aspara-CA; Elspri-CA; calciumsalt,l-asparticaci; Calcium (2S)-2-aminosuccinate; EINECS 244-185-8; CalciumL-aspartate; Calcium L-aspartic acid; calciretard; asparaginatecalcium; Di-L-Aspartate; Astos-CA; MFCD00045869; Aspartic acid (calcium) |
| Molecular Formula | C4H5CaNO4 |
| Molecular Weight | 171.165 |
| Purity | 98.00 |
| Density | 1.514g/cm3 |
| Boiling Point | 264.1ºC at 760 mmHg |
| Melting Point | 270-271ºC |
| Appearance | white powder |
| Storage Condition | Warehouse ventilation and low temperature drying |
| Application | Aspartic acid calcium (Calcium L-aspartate) is a chelate of calcium linked to L-Aspartic acid (L-aspartate). L-Aspartic acid is an amino acid that serves as the building block of proteins in the body. |
| SMILES | NC(CC(=O)O)C(=O)[O-].NC(CC(=O)O)C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C4H7NO4.Ca/c5-2(4(8)9)1-3(6)7;/h2H,1,5H2,(H,6,7)(H,8,9);/q;+2/p-2/t2-;/m0./s1 |
| InChI Key | VAFAEQCKZBKRLZ-CEOVSRFSSA-L |
| Transport Info | Product name: Calcium L-aspartate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(Methylthio)-1,3-thiazol-4(5H)-one | 20949-66-0 | 2A-9038582 |
| 3,3',5-Trihydroxybiphenyl | 20950-56-5 | 2A-9038583 |
| Amarogentin | 21018-84-8 | 2A-9038593 |
| N-(6,7-Dihydro-6-oxo-1H-purin-2-yl)-2-methylpropanamide | 21047-89-2 | 2A-9038597 |
| N-Methyl-N-thiobenzoylhydrazine | 21048-05-5 | 2A-9038598 |
| (3alpha,5beta,12alpha)-3,12-Bis(acetyloxy)-7-oxocholan-24-oic acid methyl ester | 21066-20-6 | 2A-9038601 |
| Cinnamyl chloride | 21087-29-6 | 2A-9038603 |
| Metribuzin | 21087-64-9 | 2A-9038604 |
| (1H-Indol-2-ylmethyl)amine | 21109-25-1 | 2A-9038607 |
| 1-Bromobenzocyclobutene | 21120-91-2 | 2A-9038609 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA