CAS Number21018-13-3
Synonyms2-Aethoxy-benzhydrazid; 2-ethoxy-benzoic acid hydrazide; O-ETHOXY BENZHYDRAZIDE; o-Ethoxybenzoylhydrazine; 2-Ethoxybenzoyl hydrazine; o-Ethoxy benzoic acid hydrazide; MFCD00017050; BENZOIC ACID,2-ETHOXY-,HYDRAZIDE; Benzoic acid, 2-ethoxy-, hydrazide; 2-Ethoxybenzhydrazid; 2-Ethoxybenzohydrazide
Molecular FormulaC9H12N2O2
Molecular Weight180.204
Purity98.00%
Density1.1±0.1 g/cm3
Melting Point62-64ºC
AppearanceWhite to light yellow crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 21018-13-3 |
| Catalog No. | 2A-9038592 |
| Chinese Name | 邻乙氧基苯甲酰肼 |
| Synonyms | 2-Aethoxy-benzhydrazid; 2-ethoxy-benzoic acid hydrazide; O-ETHOXY BENZHYDRAZIDE; o-Ethoxybenzoylhydrazine; 2-Ethoxybenzoyl hydrazine; o-Ethoxy benzoic acid hydrazide; MFCD00017050; BENZOIC ACID,2-ETHOXY-,HYDRAZIDE; Benzoic acid, 2-ethoxy-, hydrazide; 2-Ethoxybenzhydrazid; 2-Ethoxybenzohydrazide |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.204 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Melting Point | 62-64ºC |
| Appearance | White to light yellow crystalline powder |
| Storage Condition | room temperature, dry |
| HTC | 2928000090 |
| SMILES | CCOc1ccccc1C(=O)NN |
| InChI | InChI=1S/C9H12N2O2/c1-2-13-8-6-4-3-5-7(8)9(12)11-10/h3-6H,2,10H2,1H3,(H,11,12) |
| InChI Key | LADUENYEZHMRQH-UHFFFAOYSA-N |
| MSDS | msds/38592_1_21018_13_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 6-Nitroveratraldehyde | 20357-25-9 | 2A-9038391 |
| Ethyl 2-formyl-1-cyclopropanecarboxylate | 20417-61-2 | 2A-9038405 |
| D-Glucurono-6,3-lactone acetonide | 20513-98-8 | 2A-9038433 |
| Ethyl 2-methylcyclopropane-1-carboxylate | 20913-25-1 | 2A-9038572 |
| Glyoxal bis(N-methyl-N-phenylhydrazone) | 20915-45-1 | 2A-9038573 |
| 3-(Trifluoromethyl)benzenepropanal | 21172-41-8 | 2A-9038624 |
| 6-Chloromethylmorphanthridine | 21535-44-4 | 2A-9038696 |
| Bis(2,3-epoxypropyl) cyclohex-4-ene-1,2-dicarboxylate | 21544-03-6 | 2A-9038702 |
| 3-Cyclopentene-1-carboxylic acid ethyl ester | 21622-01-5 | 2A-9038723 |
| N-Ethyl-N-ethoxylethyl-4-amino benzaldehyde | 21635-78-9 | 2A-9038726 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS